(6E)-hydroximinocholest-3beta-ol

ID: ALA4871469

PubChem CID: 164620339

Max Phase: Preclinical

Molecular Formula: C27H47NO2

Molecular Weight: 417.68

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C/C(=N\O)C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C27H47NO2/c1-17(2)7-6-8-18(3)21-9-10-22-20-16-25(28-30)24-15-19(29)11-13-27(24,5)23(20)12-14-26(21,22)4/h17-24,29-30H,6-16H2,1-5H3/b28-25+/t18-,19+,20+,21-,22+,23+,24?,26-,27-/m1/s1

Standard InChI Key:  FXJRGBGRZZIBJR-IVKGPWHJSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    6.3281   -8.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3281   -9.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0387   -8.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7452   -8.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4559   -9.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1662   -9.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4528   -8.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1641   -8.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1717   -7.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4540   -7.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8769   -7.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8689   -8.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6510   -8.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1397   -7.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6624   -7.1831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4455   -9.0587    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8642   -9.0671    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1569   -7.8315    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7383   -7.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8724   -6.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7468   -9.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0398   -9.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6213   -9.8807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4568  -10.6949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1650  -11.1027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9217   -6.4081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3803   -5.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7225   -6.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2640   -6.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0648   -6.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6062   -7.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4070   -7.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3469   -8.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4778   -7.1814    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2 22  1  0
  4  3  1  0
  4 21  1  0
  4  7  1  0
 21  5  1  0
  5  6  1  0
  6  8  1  0
  7  8  1  0
  7 10  1  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
  7 16  1  6
 12 17  1  6
  8 18  1  1
  4 19  1  1
 11 20  1  1
 22 21  1  0
  2 23  1  1
  5 24  2  0
 24 25  1  0
 15 26  1  0
 26 27  1  6
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 15 34  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4871469

    ---

Associated Targets(Human)

PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.68Molecular Weight (Monoisotopic): 417.3607AlogP: 6.91#Rotatable Bonds: 5
Polar Surface Area: 52.82Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.50CX Basic pKa: 2.43CX LogP: 6.60CX LogD: 6.60
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: 1.98

References

1. Gomes AR, Pires AS, Abrantes AM, Gonçalves AC, Costa SC, Varela CL, Silva ET, Botelho MF, Roleira FMF..  (2021)  Design, synthesis, and antitumor activity evaluation of steroidal oximes.,  46  [PMID:34425478] [10.1016/j.bmc.2021.116360]

Source