The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2-Butylbenzofuran-3-yl)(3,5-dichloro-4-(3-(pyrrolidin-1-yl)-propoxy)phenyl)methanone ID: ALA4871502
PubChem CID: 164620723
Max Phase: Preclinical
Molecular Formula: C26H29Cl2NO3
Molecular Weight: 474.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1oc2ccccc2c1C(=O)c1cc(Cl)c(OCCCN2CCCC2)c(Cl)c1
Standard InChI: InChI=1S/C26H29Cl2NO3/c1-2-3-10-23-24(19-9-4-5-11-22(19)32-23)25(30)18-16-20(27)26(21(28)17-18)31-15-8-14-29-12-6-7-13-29/h4-5,9,11,16-17H,2-3,6-8,10,12-15H2,1H3
Standard InChI Key: QJTBXXHCMCHWJI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
0.5819 -16.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5808 -17.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2955 -18.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2937 -16.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0091 -16.9295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0094 -17.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7999 -18.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2882 -17.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7994 -16.6725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1132 -17.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5254 -16.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3504 -16.6294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7626 -15.9149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0550 -18.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 -19.4149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8620 -18.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1145 -19.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9207 -19.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4735 -19.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2145 -18.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4090 -18.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2808 -19.4851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8318 -18.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6390 -19.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7642 -17.9119 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.1755 -20.7132 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.1901 -18.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9974 -18.5977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3312 -19.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1516 -19.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3218 -18.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6066 -18.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
7 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
20 25 1 0
18 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.43Molecular Weight (Monoisotopic): 473.1524AlogP: 7.18#Rotatable Bonds: 10Polar Surface Area: 42.68Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.45CX LogP: 6.74CX LogD: 5.66Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.23Np Likeness Score: -0.52
References 1. Zhang J, Zou L, Shi D, Liu J, Zhang J, Zhao R, Wang G, Zhang L, Ouyang L, Liu B.. (2021) Structure-Guided Design of a Small-Molecule Activator of Sirtuin-3 that Modulates Autophagy in Triple Negative Breast Cancer., 64 (19.0): [PMID:34605238 ] [10.1021/acs.jmedchem.0c02268 ]