6-(1H-indol-3-yl)-1-(2,2,2-trifluoroethyl)-1H-benzo[d][1,2,3]triazole

ID: ALA4871568

PubChem CID: 164622020

Max Phase: Preclinical

Molecular Formula: C16H11F3N4

Molecular Weight: 316.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  FC(F)(F)Cn1nnc2ccc(-c3c[nH]c4ccccc34)cc21

Standard InChI:  InChI=1S/C16H11F3N4/c17-16(18,19)9-23-15-7-10(5-6-14(15)21-22-23)12-8-20-13-4-2-1-3-11(12)13/h1-8,20H,9H2

Standard InChI Key:  SSECOCRNMXVUGQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   17.0124  -15.2377    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.4252  -15.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8336  -15.2352    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.7818  -18.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7807  -19.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4887  -19.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4869  -17.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1956  -18.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2003  -19.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9804  -19.3347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4577  -18.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9726  -18.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2206  -17.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0207  -17.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9163  -15.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6719  -16.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7207  -15.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2659  -16.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0104  -15.9502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9254  -15.1397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1283  -14.9702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7180  -16.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1334  -16.3593    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  2  0
 14 18  1  0
 17 15  1  0
 15 16  2  0
 16 13  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 19 22  1  0
 22  2  1  0
  2 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871568

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.29Molecular Weight (Monoisotopic): 316.0936AlogP: 4.14#Rotatable Bonds: 2
Polar Surface Area: 46.50Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.29CX LogP: 4.13CX LogD: 4.13
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.60Np Likeness Score: -1.34

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source