(E)-N-((1H-benzo[d]imidazole-2-yl)methyl)-N-(4-(phenyldiazenyl)phenyl)benzenesulfonamide

ID: ALA4871589

PubChem CID: 164621184

Max Phase: Preclinical

Molecular Formula: C26H21N5O2S

Molecular Weight: 467.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1ccccc1)N(Cc1nc2ccccc2[nH]1)c1ccc(/N=N/c2ccccc2)cc1

Standard InChI:  InChI=1S/C26H21N5O2S/c32-34(33,23-11-5-2-6-12-23)31(19-26-27-24-13-7-8-14-25(24)28-26)22-17-15-21(16-18-22)30-29-20-9-3-1-4-10-20/h1-18H,19H2,(H,27,28)/b30-29+

Standard InChI Key:  UFRHXQOBDPLPQN-QVIHXGFCSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   12.1299   -2.3195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5426   -3.0294    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.9511   -2.3170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9610   -2.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9599   -3.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6679   -3.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3776   -3.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3747   -2.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6661   -1.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0809   -1.7973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7901   -2.2032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4963   -1.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2040   -2.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9096   -1.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9070   -0.9727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1928   -0.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4900   -0.9798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2518   -3.4397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8364   -3.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1296   -3.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4239   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4247   -4.2551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1372   -4.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8400   -4.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2511   -4.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9585   -4.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0412   -5.4789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7033   -4.3344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2496   -4.9421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8397   -5.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2458   -6.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0617   -6.3548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4698   -5.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0613   -4.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  5 18  1  0
 18  2  1  0
  2 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 18 25  1  0
 25 26  1  0
 26 27  2  0
 27 30  1  0
 29 28  1  0
 28 26  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871589

    ---

Associated Targets(Human)

CYP19A1 Tclin Cytochrome P450 19A1 (6099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.55Molecular Weight (Monoisotopic): 467.1416AlogP: 6.37#Rotatable Bonds: 7
Polar Surface Area: 90.78Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.44CX Basic pKa: 5.01CX LogP: 6.17CX LogD: 6.17
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.55

References

1. Giampietro L, Gallorini M, Gambacorta N, Ammazzalorso A, De Filippis B, Della Valle A, Fantacuzzi M, Maccallini C, Mollica A, Cataldi A, Nicolotti O, Amoroso R..  (2021)  Synthesis, structure-activity relationships and molecular docking studies of phenyldiazenyl sulfonamides as aromatase inhibitors.,  224  [PMID:34365129] [10.1016/j.ejmech.2021.113737]

Source