The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-Dichloro-5-methyl-1H-pyrrole-2-carboxamido)-4-((3-fluorobenzyl)oxy)benzo[d]thiazole-6-carboxylic acid ID: ALA4871682
PubChem CID: 150507189
Max Phase: Preclinical
Molecular Formula: C21H14Cl2FN3O4S
Molecular Weight: 494.33
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(C(=O)Nc2nc3c(OCc4cccc(F)c4)cc(C(=O)O)cc3s2)c(Cl)c1Cl
Standard InChI: InChI=1S/C21H14Cl2FN3O4S/c1-9-15(22)16(23)18(25-9)19(28)27-21-26-17-13(6-11(20(29)30)7-14(17)32-21)31-8-10-3-2-4-12(24)5-10/h2-7,25H,8H2,1H3,(H,29,30)(H,26,27,28)
Standard InChI Key: HZBPDEAJTXOHLM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.5452 -11.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2616 -11.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2587 -10.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5433 -10.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8304 -11.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8316 -10.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0437 -10.4408 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5554 -11.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0417 -11.7819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7334 -11.1096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3219 -10.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4969 -10.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7353 -9.6807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0131 -9.7215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2282 -9.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2270 -10.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0113 -11.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5584 -11.2873 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.9716 -10.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6877 -10.6907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9685 -9.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2636 -11.8433 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.5614 -9.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5408 -12.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2530 -13.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2487 -14.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5302 -14.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5255 -15.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2382 -15.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9573 -15.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9585 -14.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6680 -15.6599 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
16 18 1 0
3 19 1 0
19 20 1 0
19 21 2 0
17 22 1 0
15 23 1 0
1 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.33Molecular Weight (Monoisotopic): 493.0066AlogP: 5.91#Rotatable Bonds: 6Polar Surface Area: 104.31Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.58CX Basic pKa: ┄CX LogP: 5.66CX LogD: 2.32Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -1.72
References 1. Durcik M, Nyerges Á, Skok Ž, Skledar DG, Trontelj J, Zidar N, Ilaš J, Zega A, Cruz CD, Tammela P, Welin M, Kimbung YR, Focht D, Benek O, Révész T, Draskovits G, Szili PÉ, Daruka L, Pál C, Kikelj D, Mašič LP, Tomašič T.. (2021) New dual ATP-competitive inhibitors of bacterial DNA gyrase and topoisomerase IV active against ESKAPE pathogens., 213 [PMID:33524686 ] [10.1016/j.ejmech.2021.113200 ]