The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(2-methoxyethyl)phenyl)-1-methyl-6-((1-phenylethyl)thio)-1H-pyrazolo[3,4-d]pyrimidin-4(5H)-one ID: ALA4871871
PubChem CID: 164622975
Max Phase: Preclinical
Molecular Formula: C23H24N4O2S
Molecular Weight: 420.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCc1ccc(-n2c(SC(C)c3ccccc3)nc3c(cnn3C)c2=O)cc1
Standard InChI: InChI=1S/C23H24N4O2S/c1-16(18-7-5-4-6-8-18)30-23-25-21-20(15-24-26(21)2)22(28)27(23)19-11-9-17(10-12-19)13-14-29-3/h4-12,15-16H,13-14H2,1-3H3
Standard InChI Key: XQGAWUSJPTVXLS-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
24.2502 -7.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2490 -8.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9571 -9.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6667 -8.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6639 -7.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9553 -7.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5376 -9.0139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8269 -8.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8313 -10.2427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5394 -9.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8283 -7.7814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1152 -9.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1160 -9.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3323 -8.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8470 -9.4186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3310 -10.0859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0777 -10.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2472 -10.2387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.2476 -11.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9556 -11.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9510 -12.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6581 -12.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3665 -12.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3634 -11.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6557 -11.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5402 -11.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3701 -7.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0793 -7.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7855 -7.3637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4947 -7.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 13 1 0
12 9 1 0
9 10 2 0
10 7 1 0
8 11 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
16 17 1 0
10 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
5 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.54Molecular Weight (Monoisotopic): 420.1620AlogP: 4.16#Rotatable Bonds: 7Polar Surface Area: 61.94Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.64CX LogD: 4.64Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: -1.72
References 1. Huddle BC, Grimley E, Chtcherbinine M, Buchman CD, Takahashi C, Debnath B, McGonigal SC, Mao S, Li S, Felton J, Pan S, Wen B, Sun D, Neamati N, Buckanovich RJ, Hurley TD, Larsen SD.. (2021) Development of 2,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one inhibitors of aldehyde dehydrogenase 1A (ALDH1A) as potential adjuncts to ovarian cancer chemotherapy., 211 [PMID:33341649 ] [10.1016/j.ejmech.2020.113060 ]