The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(5-chloro-2-((3,5-difluorophenyl)amino)pyrimidin-4-yl)-N-(4-(dimethylamino)-3-(pyrrolidine-1-carbonyl)phenyl)pyrrolidine-2-carboxamide ID: ALA4871876
PubChem CID: 164622979
Max Phase: Preclinical
Molecular Formula: C28H30ClF2N7O2
Molecular Weight: 570.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(NC(=O)[C@@H]2CCCN2c2nc(Nc3cc(F)cc(F)c3)ncc2Cl)cc1C(=O)N1CCCC1
Standard InChI: InChI=1S/C28H30ClF2N7O2/c1-36(2)23-8-7-19(15-21(23)27(40)37-9-3-4-10-37)33-26(39)24-6-5-11-38(24)25-22(29)16-32-28(35-25)34-20-13-17(30)12-18(31)14-20/h7-8,12-16,24H,3-6,9-11H2,1-2H3,(H,33,39)(H,32,34,35)/t24-/m0/s1
Standard InChI Key: ZMTOETGINHMQOZ-DEOSSOPVSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
35.7798 -20.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5829 -20.5485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4419 -19.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7781 -19.2957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3334 -17.9432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1358 -18.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6909 -19.5638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0051 -19.5679 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.5530 -18.3386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1662 -18.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5594 -19.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3808 -17.6203 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.1386 -19.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8287 -19.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0017 -18.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4380 -20.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9905 -19.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3919 -18.1698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9977 -17.8755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4247 -17.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9802 -19.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7158 -19.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4223 -17.1034 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8497 -19.5668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2669 -19.5650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9794 -18.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7767 -18.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4265 -19.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3872 -19.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2190 -19.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6119 -18.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7170 -18.3369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2593 -17.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8285 -20.3552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6593 -21.1556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6029 -20.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0788 -17.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9894 -16.7887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1856 -16.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7783 -17.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24 11 1 0
22 28 1 0
16 30 2 0
14 16 1 0
29 27 2 0
26 12 1 0
27 15 1 0
13 24 1 0
30 29 1 0
10 4 2 0
20 32 1 0
20 23 1 0
25 21 1 0
22 8 1 0
28 13 2 0
10 5 1 0
31 18 1 0
26 33 1 0
21 26 2 0
3 31 1 6
3 7 1 0
11 25 2 0
31 19 2 0
6 20 2 0
32 22 2 0
17 3 1 0
1 2 1 0
21 7 1 0
13 6 1 0
7 1 1 0
2 17 1 0
18 15 1 0
9 11 1 0
29 10 1 0
15 14 2 0
33 9 2 0
34 35 1 0
34 36 1 0
30 34 1 0
5 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.04Molecular Weight (Monoisotopic): 569.2118AlogP: 5.06#Rotatable Bonds: 7Polar Surface Area: 93.70Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.06CX Basic pKa: 3.83CX LogP: 5.10CX LogD: 5.10Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.41Np Likeness Score: -1.80
References 1. Li T, Li C, Yang J, Guo M, Cao Z, Wang X, Jiang N, Zhai X.. (2021) Discovery of novel 2-phenylamino-4-prolylpyrimidine derivatives as TRK/ALK dual inhibitors with promising antitumor effects., 47 [PMID:34534734 ] [10.1016/j.bmc.2021.116396 ]