2-Oxo-N-(4-(N-phenylsulfamoyl)phenyl)-2H-chromene-3-carboxamide

ID: ALA4871933

PubChem CID: 24638090

Max Phase: Preclinical

Molecular Formula: C22H16N2O5S

Molecular Weight: 420.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1cc2ccccc2oc1=O

Standard InChI:  InChI=1S/C22H16N2O5S/c25-21(19-14-15-6-4-5-9-20(15)29-22(19)26)23-16-10-12-18(13-11-16)30(27,28)24-17-7-2-1-3-8-17/h1-14,24H,(H,23,25)

Standard InChI Key:  RBKXGVALYOHUQF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   11.9896   -5.5429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4023   -6.2528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.8107   -5.5404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8709   -7.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1619   -7.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8709   -6.6652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5759   -7.8910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2850   -7.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9941   -7.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6991   -7.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6991   -6.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9941   -6.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2850   -6.6652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0982   -6.6825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0753   -7.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7716   -7.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7487   -8.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0295   -9.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3332   -8.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3561   -7.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4586   -7.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4550   -9.1148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1681   -8.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7467   -8.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7537   -7.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0517   -7.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3424   -7.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3394   -8.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0419   -9.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8763   -9.1158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  6  2  0
  4  7  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
  2 14  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 15 20  2  0
 14 15  1  0
 11  2  1  0
  7  8  1  0
  5 21  2  0
  5 23  1  0
 21 25  1  0
 24 22  1  0
 22 23  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 23 30  2  0
M  END

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.45Molecular Weight (Monoisotopic): 420.0780AlogP: 3.85#Rotatable Bonds: 5
Polar Surface Area: 105.48Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.94CX Basic pKa: CX LogP: 3.29CX LogD: 3.20
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -1.39

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source