(3aS,4S,6aR)-3a-(3-boronopropyl)octahydropyrrolo[3,4-b]pyrrole-4-carboxylic acid

ID: ALA4871970

PubChem CID: 164623497

Max Phase: Preclinical

Molecular Formula: C10H19BN2O4

Molecular Weight: 242.08

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)[C@H]1NC[C@@H]2NCC[C@@]21CCCB(O)O

Standard InChI:  InChI=1S/C10H19BN2O4/c14-9(15)8-10(2-1-4-11(16)17)3-5-12-7(10)6-13-8/h7-8,12-13,16-17H,1-6H2,(H,14,15)/t7-,8+,10-/m0/s1

Standard InChI Key:  MSAMXQQWSGPTCK-XKSSXDPKSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   30.2965  -14.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1178  -14.8311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4555  -14.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8372  -13.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1277  -13.9389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4138  -14.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7009  -13.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9845  -14.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2737  -13.9427    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   26.5562  -14.3569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2737  -13.1224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5092  -13.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8378  -12.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6591  -12.7134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5511  -13.1054    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.7441  -15.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9379  -15.1843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9978  -16.1411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  0
  5  1  1  0
  5  6  1  6
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 12  5  1  0
 13 12  1  0
 14 13  1  0
  4 14  1  0
  4 15  1  6
  1 16  1  6
 16 17  2  0
 16 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871970

    ---

Associated Targets(Human)

ARG1 Tchem Arginase-1 (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 242.08Molecular Weight (Monoisotopic): 242.1438AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Li D, Zhang H, Lyons TW, Lu M, Achab A, Pu Q, Childers M, Mitcheltree MJ, Wang J, Martinot TA, McMinn SE, Sloman DL, Palani A, Beard A, Nogle L, Gathiaka S, Saurí J, Kim HY, Adpressa D, Spacciapoli P, Miller JR, Palte RL, Lesburg CA, Cumming J, Fischer C..  (2021)  Comprehensive Strategies to Bicyclic Prolines: Applications in the Synthesis of Potent Arginase Inhibitors.,  12  (11.0): [PMID:34795856] [10.1021/acsmedchemlett.1c00258]

Source