2-(3-fluoro-2-hydroxyphenyl)-5-(5-(hydroxymethyl)thiophen-2-yl)-6-methyl-3-phenethylpyrimidin-4(3H)-one

ID: ALA4871972

PubChem CID: 164623498

Max Phase: Preclinical

Molecular Formula: C24H21FN2O3S

Molecular Weight: 436.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cccc(F)c2O)n(CCc2ccccc2)c(=O)c1-c1ccc(CO)s1

Standard InChI:  InChI=1S/C24H21FN2O3S/c1-15-21(20-11-10-17(14-28)31-20)24(30)27(13-12-16-6-3-2-4-7-16)23(26-15)18-8-5-9-19(25)22(18)29/h2-11,28-29H,12-14H2,1H3

Standard InChI Key:  IKHPDBNPSSKDDD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   35.5340   -4.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5329   -4.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2409   -5.2484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9506   -4.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9478   -4.0163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2391   -3.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6554   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6554   -6.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3629   -6.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0709   -6.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0670   -5.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3589   -4.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8248   -5.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2367   -2.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8262   -3.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7405   -2.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9412   -2.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5327   -3.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0797   -3.9447    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.7200   -3.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6539   -3.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3632   -4.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0693   -3.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7770   -4.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4827   -3.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4800   -2.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7658   -2.3746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0631   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9479   -6.4729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3638   -7.2886    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.2395   -2.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  2 13  1  0
  6 14  2  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
  1 15  1  0
 18 20  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  8 29  1  0
  9 30  1  0
 20 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871972

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.51Molecular Weight (Monoisotopic): 436.1257AlogP: 4.53#Rotatable Bonds: 6
Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.70CX Basic pKa: CX LogP: 4.57CX LogD: 4.39
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.74

References

1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW..  (2021)  Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction.,  12  (9.0): [PMID:34531948] [10.1021/acsmedchemlett.1c00187]

Source