The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-methoxyphenyl)-4,5-bis(4-methoxyphenyl)-1H-imidazole ID: ALA4872006
PubChem CID: 164624734
Max Phase: Preclinical
Molecular Formula: C24H22N2O3
Molecular Weight: 386.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc(-c3ccccc3OC)[nH]c2-c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C24H22N2O3/c1-27-18-12-8-16(9-13-18)22-23(17-10-14-19(28-2)15-11-17)26-24(25-22)20-6-4-5-7-21(20)29-3/h4-15H,1-3H3,(H,25,26)
Standard InChI Key: QLRFSGDHYDVBLH-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
9.3877 -8.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2134 -8.9081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4704 -8.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8006 -7.6362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1349 -8.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2524 -7.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8652 -8.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6502 -8.1695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8236 -7.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2058 -6.8070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4231 -7.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9020 -9.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0799 -9.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5938 -10.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9287 -10.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7544 -10.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2368 -10.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3517 -7.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1807 -7.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3961 -6.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7818 -7.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9573 -8.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7417 -8.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8088 -6.5117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9793 -5.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4434 -11.5741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6222 -11.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9960 -7.1065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8229 -6.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
1 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
5 18 1 0
11 24 1 0
24 25 1 0
15 26 1 0
26 27 1 0
21 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.45Molecular Weight (Monoisotopic): 386.1630AlogP: 5.44#Rotatable Bonds: 6Polar Surface Area: 56.37Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.84CX Basic pKa: 4.68CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -0.57
References 1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K.. (2020) Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?, 11 (4.0): [PMID:33479649 ] [10.1039/D0MD00062K ]