N-(2,3-Dimethylphenyl)-4-(2-oxo-2-((3-(trifluoromethyl)benzyl)-amino)ethoxy)benzamide

ID: ALA4872026

PubChem CID: 164623506

Max Phase: Preclinical

Molecular Formula: C25H23F3N2O3

Molecular Weight: 456.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(NC(=O)c2ccc(OCC(=O)NCc3cccc(C(F)(F)F)c3)cc2)c1C

Standard InChI:  InChI=1S/C25H23F3N2O3/c1-16-5-3-8-22(17(16)2)30-24(32)19-9-11-21(12-10-19)33-15-23(31)29-14-18-6-4-7-20(13-18)25(26,27)28/h3-13H,14-15H2,1-2H3,(H,29,31)(H,30,32)

Standard InChI Key:  BSUAETFFMVMLKW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   14.7260   -3.6650    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431   -3.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1381   -2.9552    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.5431   -4.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2567   -4.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2567   -5.7139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5470   -6.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8390   -5.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8390   -4.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9650   -6.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6721   -5.7117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3804   -6.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0875   -5.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7958   -6.1170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5029   -5.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2084   -6.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9142   -5.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9142   -4.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2008   -4.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5029   -4.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6207   -4.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6207   -3.6600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3296   -4.8838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0361   -4.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7421   -4.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4481   -4.4702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4481   -3.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7324   -3.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0361   -3.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1568   -4.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7421   -5.6973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3804   -6.9364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2502   -3.2587    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  8  9  2  0
  4  9  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 26 30  1  0
 25 31  1  0
 12 32  2  0
  2 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872026

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.46Molecular Weight (Monoisotopic): 456.1661AlogP: 5.27#Rotatable Bonds: 7
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.86CX Basic pKa: CX LogP: 5.43CX LogD: 5.43
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.80

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source