The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-hydroxy-2-(4-hydroxyphenyl)-4-oxochroman-7-yl piperidine-1-carboxylate ID: ALA4872071
PubChem CID: 164624318
Max Phase: Preclinical
Molecular Formula: C21H21NO6
Molecular Weight: 383.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CC(c2ccc(O)cc2)Oc2cc(OC(=O)N3CCCCC3)cc(O)c21
Standard InChI: InChI=1S/C21H21NO6/c23-14-6-4-13(5-7-14)18-12-17(25)20-16(24)10-15(11-19(20)28-18)27-21(26)22-8-2-1-3-9-22/h4-7,10-11,18,23-24H,1-3,8-9,12H2
Standard InChI Key: JJBJGWQQJZMGGD-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
4.4560 -5.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4548 -5.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1629 -6.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8726 -5.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8697 -5.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1611 -4.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7468 -6.3370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5759 -4.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2825 -5.1028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2786 -3.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5683 -3.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9877 -3.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9836 -4.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6885 -5.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3978 -4.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3979 -3.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6925 -3.4721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2783 -2.6522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6929 -2.6549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1047 -5.1095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8132 -4.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5201 -5.1123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8148 -3.8851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5154 -5.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2183 -6.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9292 -5.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9327 -5.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2254 -4.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
17 19 1 0
15 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
22 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 383.40Molecular Weight (Monoisotopic): 383.1369AlogP: 3.79#Rotatable Bonds: 2Polar Surface Area: 96.30Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.20CX Basic pKa: ┄CX LogP: 3.71CX LogD: 3.65Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: 0.73
References 1. Wu J, Kou X, Ju H, Zhang H, Yang A, Shen R.. (2021) Design, synthesis and biological evaluation of naringenin carbamate derivatives as potential multifunctional agents for the treatment of Alzheimer's disease., 49 [PMID:34391893 ] [10.1016/j.bmcl.2021.128316 ]