The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-((S,E)-1-fluoro-5-phenyl-1-(phenylsulfonyl)pent-1-en-3-ylamino)-1-oxo-3-p-tolylpropan-2-yl)isonicotinamide ID: ALA4872080
PubChem CID: 164624324
Max Phase: Preclinical
Molecular Formula: C33H32FN3O4S
Molecular Weight: 585.70
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C[C@H](NC(=O)c2ccncc2)C(=O)N[C@H](/C=C(\F)S(=O)(=O)c2ccccc2)CCc2ccccc2)cc1
Standard InChI: InChI=1S/C33H32FN3O4S/c1-24-12-14-26(15-13-24)22-30(37-32(38)27-18-20-35-21-19-27)33(39)36-28(17-16-25-8-4-2-5-9-25)23-31(34)42(40,41)29-10-6-3-7-11-29/h2-15,18-21,23,28,30H,16-17,22H2,1H3,(H,36,39)(H,37,38)/b31-23+/t28-,30-/m0/s1
Standard InChI Key: HIMPUEOUSQGDGJ-XGNJWNESSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
20.4876 -6.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0790 -6.1991 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.6700 -6.9064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3916 -6.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1035 -5.7905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8153 -6.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3916 -7.0245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8153 -7.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5272 -5.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2390 -6.2032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9467 -5.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5272 -4.9692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5272 -7.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5227 -8.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2337 -8.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9424 -8.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9397 -7.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2323 -7.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6585 -6.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3704 -5.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9467 -4.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2390 -4.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2390 -3.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9488 -3.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9491 -2.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2409 -2.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5267 -2.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5298 -3.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3694 -4.9692 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.7847 -5.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4946 -6.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1999 -5.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1958 -4.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4805 -4.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7781 -4.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6868 -5.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6874 -4.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9801 -4.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2718 -4.9791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2752 -5.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9830 -6.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6506 -8.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
4 7 2 0
6 8 1 6
6 9 1 0
9 10 1 0
10 11 1 0
9 12 2 0
8 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 1 0
19 20 2 0
20 2 1 0
11 21 1 1
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
20 29 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
4 36 1 0
16 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.70Molecular Weight (Monoisotopic): 585.2098AlogP: 5.13#Rotatable Bonds: 12Polar Surface Area: 105.23Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.55CX Basic pKa: 3.39CX LogP: 6.10CX LogD: 6.10Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -0.51
References 1. Jung S, Fuchs N, Johe P, Wagner A, Diehl E, Yuliani T, Zimmer C, Barthels F, Zimmermann RA, Klein P, Waigel W, Meyr J, Opatz T, Tenzer S, Distler U, Räder HJ, Kersten C, Engels B, Hellmich UA, Klein J, Schirmeister T.. (2021) Fluorovinylsulfones and -Sulfonates as Potent Covalent Reversible Inhibitors of the Trypanosomal Cysteine Protease Rhodesain: Structure-Activity Relationship, Inhibition Mechanism, Metabolism, and In Vivo Studies., 64 (16.0): [PMID:34378914 ] [10.1021/acs.jmedchem.1c01002 ]