The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[1,1'-Biphenyl]-4-yl(9-(2-(diethylamino)ethyl)-2-methyl-9H-benzo[d]imidazo [1,2-a]imidazole-3-yl)methanone ID: ALA4872096
PubChem CID: 164624742
Max Phase: Preclinical
Molecular Formula: C29H30N4O
Molecular Weight: 450.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCn1c2ccccc2n2c(C(=O)c3ccc(-c4ccccc4)cc3)c(C)nc12
Standard InChI: InChI=1S/C29H30N4O/c1-4-31(5-2)19-20-32-25-13-9-10-14-26(25)33-27(21(3)30-29(32)33)28(34)24-17-15-23(16-18-24)22-11-7-6-8-12-22/h6-18H,4-5,19-20H2,1-3H3
Standard InChI Key: BOTAUGIOASSDMJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
13.5185 -8.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2230 -7.8382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8296 -7.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1013 -8.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4132 -7.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4516 -6.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1799 -6.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8689 -6.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1208 -10.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4666 -10.8166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8006 -10.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0484 -9.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8640 -9.5530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9412 -10.3252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1882 -9.5450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5230 -9.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4972 -8.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6991 -9.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4521 -9.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0024 -10.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9617 -9.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4711 -11.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7657 -12.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7702 -12.8609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4592 -13.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1874 -12.9278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0657 -13.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0702 -14.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7663 -6.4904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8069 -5.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1205 -5.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3930 -5.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3562 -6.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0434 -6.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
1 3 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
9 13 1 0
14 15 1 0
15 16 2 0
13 16 1 0
9 14 2 0
17 18 1 0
18 19 2 0
19 20 1 0
11 20 2 0
12 17 2 0
15 21 1 0
22 23 1 0
25 26 1 0
24 25 1 0
27 28 1 0
24 27 1 0
23 24 1 0
10 22 1 0
1 16 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
6 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.59Molecular Weight (Monoisotopic): 450.2420AlogP: 5.84#Rotatable Bonds: 8Polar Surface Area: 42.54Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.21CX LogP: 5.18CX LogD: 3.37Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.28Np Likeness Score: -1.17
References 1. Zhao S, Zhang H, Jin H, Cai X, Zhang R, Jin Z, Yang W, Yu P, Zhang L, Liu Z.. (2021) Design, synthesis and biological activities of benzo[d]imidazo[1,2-a]imidazole derivatives as TRPM2-specfic inhibitors., 225 [PMID:34416664 ] [10.1016/j.ejmech.2021.113750 ]