The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(4-(4-(2-oxopyridin-1(2H)-yl)phenyl)piperazin-1-yl)butyl)-1H-indole-5-carbonitrile ID: ALA4872189
PubChem CID: 118190877
Max Phase: Preclinical
Molecular Formula: C28H29N5O
Molecular Weight: 451.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc(-n5ccccc5=O)cc4)CC3)c2c1
Standard InChI: InChI=1S/C28H29N5O/c29-20-22-7-12-27-26(19-22)23(21-30-27)5-1-3-13-31-15-17-32(18-16-31)24-8-10-25(11-9-24)33-14-4-2-6-28(33)34/h2,4,6-12,14,19,21,30H,1,3,5,13,15-18H2
Standard InChI Key: HWNWJCBFFGHPGX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
19.3591 -2.8479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4439 -3.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6900 -4.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1416 -3.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3172 -3.3909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9050 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3172 -1.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1416 -1.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5537 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0807 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2563 -2.6798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5220 -4.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1338 -5.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9281 -5.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5114 -5.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3099 -5.5183 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5207 -4.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3192 -4.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9026 -5.0924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6876 -5.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8933 -6.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6969 -4.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9118 -4.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7061 -3.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2896 -4.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0788 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2803 -5.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2989 -3.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0973 -3.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6807 -3.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4657 -4.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6672 -4.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0839 -4.2406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7155 -2.8588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 3 0
6 10 1 0
12 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 1 0
28 34 2 0
25 33 1 0
19 22 1 0
15 16 1 0
3 12 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.57Molecular Weight (Monoisotopic): 451.2372AlogP: 4.34#Rotatable Bonds: 7Polar Surface Area: 68.06Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.59CX LogP: 4.71CX LogD: 3.49Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.31
References 1. Xu T, Xue Y, Lu J, Jin C.. (2021) Synthesis and biological evaluation of 1-(4-(piperazin-1-yl)phenyl)pyridin-2(1H)-one derivatives as potential SSRIs., 223 [PMID:34182358 ] [10.1016/j.ejmech.2021.113644 ]