1-(3-fluoro-4-(4-(4-fluorobenzoyl)piperazin-1-yl)phenyl)ethanone

ID: ALA4872245

PubChem CID: 697890

Max Phase: Preclinical

Molecular Formula: C19H18F2N2O2

Molecular Weight: 344.36

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)c1ccc(N2CCN(C(=O)c3ccc(F)cc3)CC2)c(F)c1

Standard InChI:  InChI=1S/C19H18F2N2O2/c1-13(24)15-4-7-18(17(21)12-15)22-8-10-23(11-9-22)19(25)14-2-5-16(20)6-3-14/h2-7,12H,8-11H2,1H3

Standard InChI Key:  GTODBMTUYFVLJS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   31.6255   -1.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6244   -2.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3324   -3.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0421   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0393   -1.9816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3306   -1.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9199   -3.2105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2127   -2.7991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5068   -3.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5019   -4.0212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2091   -4.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9212   -4.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9177   -1.5767    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.7454   -1.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4547   -1.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7424   -0.7531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7923   -4.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0865   -4.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7886   -5.2438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0937   -3.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3887   -2.7878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6781   -3.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6770   -4.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3826   -4.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9717   -2.7824    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  2  7  1  0
  1 13  1  0
  5 14  1  0
 14 15  1  0
 14 16  2  0
 10 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 18  1  0
 22 25  1  0
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.36Molecular Weight (Monoisotopic): 344.1336AlogP: 3.13#Rotatable Bonds: 3
Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.85CX LogD: 2.85
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.80Np Likeness Score: -1.66

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source