N-(5-chloropyridin-2-yl)-2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)acetamide

ID: ALA4872280

PubChem CID: 164619042

Max Phase: Preclinical

Molecular Formula: C21H14ClI2N5O4S2

Molecular Weight: 753.77

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccc(Cl)cn3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C21H14ClI2N5O4S2/c22-11-1-6-17(26-9-11)27-18(30)10-34-21-28-19-15(7-12(23)8-16(19)24)20(31)29(21)13-2-4-14(5-3-13)35(25,32)33/h1-9H,10H2,(H2,25,32,33)(H,26,27,30)

Standard InChI Key:  GIBYSRKPBUAFOT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    7.7262  -16.7689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1389  -17.4788    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.5473  -16.7664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4667  -19.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4655  -19.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1736  -20.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1718  -18.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8804  -19.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8792  -19.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5893  -20.3378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3051  -19.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3063  -19.1034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5917  -18.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7589  -18.6965    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    3.1733  -21.1506    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    4.5917  -17.8703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0133  -18.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7203  -19.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4285  -18.7049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4310  -17.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7193  -17.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0140  -17.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0117  -20.3391    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.8464  -17.8884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7206  -19.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4271  -20.3431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1360  -19.9365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4248  -21.1603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8425  -20.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8355  -21.1614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5412  -21.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2510  -21.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2507  -20.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5444  -19.9370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9581  -21.5749    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872280

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 753.77Molecular Weight (Monoisotopic): 752.8265AlogP: 4.02#Rotatable Bonds: 6
Polar Surface Area: 137.04Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.11CX Basic pKa: 2.10CX LogP: 5.07CX LogD: 5.07
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -2.39

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source