3-(2,4-dichlorophenyl)-N1-hydroxy-N5-(3-hydroxybenzyl)pentanediamide

ID: ALA4872321

PubChem CID: 164619051

Max Phase: Preclinical

Molecular Formula: C18H18Cl2N2O4

Molecular Weight: 397.26

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CC(CC(=O)NCc1cccc(O)c1)c1ccc(Cl)cc1Cl)NO

Standard InChI:  InChI=1S/C18H18Cl2N2O4/c19-13-4-5-15(16(20)9-13)12(8-18(25)22-26)7-17(24)21-10-11-2-1-3-14(23)6-11/h1-6,9,12,23,26H,7-8,10H2,(H,21,24)(H,22,25)

Standard InChI Key:  GUYBIDSOBSYRIO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   35.2630  -19.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9749  -18.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6867  -19.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3985  -18.9605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1104  -19.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8181  -18.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5246  -19.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2318  -18.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2318  -18.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5196  -17.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8181  -18.1492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6867  -20.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5512  -18.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5512  -18.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8451  -17.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1323  -18.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1323  -18.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8465  -19.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4241  -17.7265    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.2693  -17.7277    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.2630  -20.1904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5512  -20.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5512  -21.4244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8394  -21.8330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8394  -20.1904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5161  -16.9217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3 12  2  0
  1 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 14 20  1  0
  1 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  2  0
 10 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872321

    ---

Associated Targets(non-human)

botA Botulinum neurotoxin type A (1303 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 397.26Molecular Weight (Monoisotopic): 396.0644AlogP: 3.38#Rotatable Bonds: 7
Polar Surface Area: 98.66Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 8.79CX Basic pKa: CX LogP: 2.70CX LogD: 2.68
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.43Np Likeness Score: -0.56

References

1. Turner LD, Nielsen AL, Lin L, Campedelli AJ, Silvaggi NR, Chen JS, Wakefield AE, Allen KN, Janda KD..  (2021)  Use of Crystallography and Molecular Modeling for the Inhibition of the Botulinum Neurotoxin A Protease.,  12  (8.0): [PMID:34413962] [10.1021/acsmedchemlett.1c00325]

Source