3-((1-benzoyl-4-hydroxypiperidin-4-yl)methyl)-7-chloroquinazolin-4(3H)-one

ID: ALA4872324

PubChem CID: 164619054

Max Phase: Preclinical

Molecular Formula: C21H20ClN3O3

Molecular Weight: 397.86

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccccc1)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1

Standard InChI:  InChI=1S/C21H20ClN3O3/c22-16-6-7-17-18(12-16)23-14-25(20(17)27)13-21(28)8-10-24(11-9-21)19(26)15-4-2-1-3-5-15/h1-7,12,14,28H,8-11,13H2

Standard InChI Key:  LFBSBBLLAXMRQG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    1.0056  -11.4256    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.7191  -11.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4342  -11.4237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4229   -9.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7127  -10.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1445  -10.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1441  -11.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8523  -11.4142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5655  -11.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5659  -10.1830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8532   -9.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8525   -8.9433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2816   -9.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9961  -10.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9890  -11.0101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6993  -11.4239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4174  -11.0157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4207  -10.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7058   -9.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2052   -9.3830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1304  -11.4324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1259  -12.2581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8475  -11.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5574  -11.4444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2741  -11.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2790  -10.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5611   -9.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8472  -10.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 20  1  0
 17 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872324

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.86Molecular Weight (Monoisotopic): 397.1193AlogP: 2.72#Rotatable Bonds: 3
Polar Surface Area: 75.43Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 1.89CX LogD: 1.89
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: -1.10

References

1. Li P, Liu Y, Yang H, Liu HM..  (2021)  Design, synthesis, biological evaluation and structure-activity relationship study of quinazolin-4(3H)-one derivatives as novel USP7 inhibitors.,  216  [PMID:33684824] [10.1016/j.ejmech.2021.113291]

Source