5-cyclopropyl-5-[3-[4-(3,5-dichlorophenyl)-1-piperidyl]-3-oxo-propyl]imidazolidine-2,4-dione

ID: ALA4872381

PubChem CID: 132211396

Max Phase: Preclinical

Molecular Formula: C20H23Cl2N3O3

Molecular Weight: 424.33

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)C(CCC(=O)N2CCC(c3cc(Cl)cc(Cl)c3)CC2)(C2CC2)N1

Standard InChI:  InChI=1S/C20H23Cl2N3O3/c21-15-9-13(10-16(22)11-15)12-4-7-25(8-5-12)17(26)3-6-20(14-1-2-14)18(27)23-19(28)24-20/h9-12,14H,1-8H2,(H2,23,24,27,28)

Standard InChI Key:  RZGFJNCYMGRZKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    8.9358   -9.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6014   -8.5305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2666   -9.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0133   -9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1884   -9.7996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1513   -8.7615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0514   -8.7630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8192   -9.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0759  -10.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8818  -10.9303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1385  -11.7150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4351  -10.3184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1785   -9.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7318   -8.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5376   -9.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7943   -9.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2409  -10.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0910   -8.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8343   -7.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3876   -7.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1935   -7.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4502   -8.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8969   -8.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9281  -10.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2611  -11.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4430  -11.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1342   -6.2966    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.2571   -8.2107    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  1  6  2  0
  3  7  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 12 17  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
 15 18  1  0
 10 12  1  0
  4  8  1  0
 24 25  1  0
 25 26  1  0
 24 26  1  0
  4 24  1  0
 20 27  1  0
 22 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872381

    ---

Associated Targets(Human)

ADAMTS5 Tchem ADAMTS5 (711 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.33Molecular Weight (Monoisotopic): 423.1116AlogP: 3.47#Rotatable Bonds: 5
Polar Surface Area: 78.51Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.90CX Basic pKa: CX LogP: 2.74CX LogD: 2.73
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.71Np Likeness Score: -0.76

References

1. Brebion F, Gosmini R, Deprez P, Varin M, Peixoto C, Alvey L, Jary H, Bienvenu N, Triballeau N, Blanque R, Cottereaux C, Christophe T, Vandervoort N, Mollat P, Touitou R, Leonard P, De Ceuninck F, Botez I, Monjardet A, van der Aar E, Amantini D..  (2021)  Discovery of GLPG1972/S201086, a Potent, Selective, and Orally Bioavailable ADAMTS-5 Inhibitor for the Treatment of Osteoarthritis.,  64  (6.0): [PMID:33719441] [10.1021/acs.jmedchem.0c02008]

Source