The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[4-(trifluoromethyl)phenyl]-3-[(7S)-1,2,3-trimethoxy-10-(methylamino)-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]urea ID: ALA4872420
PubChem CID: 164622521
Max Phase: Preclinical
Molecular Formula: C28H28F3N3O5
Molecular Weight: 543.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1ccc2c(cc1=O)[C@@H](NC(=O)Nc1ccc(C(F)(F)F)cc1)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C28H28F3N3O5/c1-32-21-12-10-18-19(14-22(21)35)20(34-27(36)33-17-8-6-16(7-9-17)28(29,30)31)11-5-15-13-23(37-2)25(38-3)26(39-4)24(15)18/h6-10,12-14,20H,5,11H2,1-4H3,(H,32,35)(H2,33,34,36)/t20-/m0/s1
Standard InChI Key: PLPPLUVHHASPME-FQEVSTJZSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
15.0052 -2.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0040 -3.3247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7080 -3.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7062 -2.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4141 -3.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4148 -2.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0567 -1.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8578 -2.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2109 -2.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0567 -3.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8602 -3.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5094 -4.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6960 -4.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5146 -4.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0596 -5.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8686 -5.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0521 -6.2992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4543 -6.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2477 -5.3463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0240 -2.9081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4311 -2.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2441 -2.1977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0209 -1.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7088 -4.5468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3001 -3.7328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3015 -2.1050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3013 -1.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5969 -3.3236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0057 -4.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6543 -2.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2445 -3.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6539 -4.3155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4720 -4.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8788 -3.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4670 -2.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8831 -5.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4770 -5.7296 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.7003 -5.0176 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.2870 -5.7245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 10 1 0
7 8 1 0
8 9 1 0
11 9 1 0
10 11 1 0
11 12 2 0
10 13 2 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 2 0
16 17 1 0
17 18 1 0
14 19 2 0
9 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
3 24 1 0
2 25 1 0
1 26 1 0
26 27 1 0
25 28 1 0
24 29 1 0
22 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.54Molecular Weight (Monoisotopic): 543.1981AlogP: 5.61#Rotatable Bonds: 6Polar Surface Area: 97.92Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.49CX Basic pKa: 3.80CX LogP: 3.93CX LogD: 3.93Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -0.22
References 1. Krzywik J, Maj E, Nasulewicz-Goldeman A, Mozga W, Wietrzyk J, Huczyński A.. (2021) Synthesis and antiproliferative screening of novel doubly modified colchicines containing urea, thiourea and guanidine moieties., 47 [PMID:34116158 ] [10.1016/j.bmcl.2021.128197 ]