1-(1-(4-methylbenzoyl)-1H-indol-5-yl)-3-(pyridin-4-ylmethyl)urea

ID: ALA4872450

PubChem CID: 164622540

Max Phase: Preclinical

Molecular Formula: C23H20N4O2

Molecular Weight: 384.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)n2ccc3cc(NC(=O)NCc4ccncc4)ccc32)cc1

Standard InChI:  InChI=1S/C23H20N4O2/c1-16-2-4-18(5-3-16)22(28)27-13-10-19-14-20(6-7-21(19)27)26-23(29)25-15-17-8-11-24-12-9-17/h2-14H,15H2,1H3,(H2,25,26,29)

Standard InChI Key:  GBVLWXZHPKLANI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   24.1237  -11.3829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8314  -10.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5391  -11.3829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2468  -10.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4159  -10.9743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8314  -10.1571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7082  -11.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0011  -10.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2939  -11.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2934  -12.1972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0061  -12.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7104  -12.1953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9532  -11.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9481   -9.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2438  -10.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6608  -10.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6614  -10.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4356  -11.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9136  -10.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4347   -9.9094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6866   -9.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4858   -8.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0302   -9.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8288   -9.4007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0814   -8.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5294   -8.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7329   -8.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8804   -8.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1394   -8.5251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  1  0
  2  6  2  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  2  0
 13 17  1  0
 16 14  1  0
 14 15  2  0
 15  4  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 21 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4872450

    ---

Associated Targets(Human)

NAMPT Tchem Nicotinamide phosphoribosyltransferase (3221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 384.44Molecular Weight (Monoisotopic): 384.1586AlogP: 4.35#Rotatable Bonds: 4
Polar Surface Area: 76.02Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.32CX Basic pKa: 5.02CX LogP: 3.39CX LogD: 3.39
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.67

References

1. Akiu M, Tsuji T, Sogawa Y, Terayama K, Yokoyama M, Tanaka J, Asano D, Sakurai K, Sergienko E, Sessions EH, Gardell SJ, Pinkerton AB, Nakamura T..  (2021)  Discovery of 1-[2-(1-methyl-1H-pyrazol-5-yl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3-(pyridin-4-ylmethyl)urea as a potent NAMPT (nicotinamide phosphoribosyltransferase) activator with attenuated CYP inhibition.,  43  [PMID:33887438] [10.1016/j.bmcl.2021.128048]

Source