2-[[4-[4-(5-fluoro-2-methoxy-phenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]cyclohex-3-en-1-yl]amino]acetic acid

ID: ALA4872494

PubChem CID: 90419536

Max Phase: Preclinical

Molecular Formula: C22H22FN3O3

Molecular Weight: 395.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CCC(NCC(=O)O)CC3)cc12

Standard InChI:  InChI=1S/C22H22FN3O3/c1-29-20-7-4-14(23)10-17(20)16-8-9-24-22-18(16)11-19(26-22)13-2-5-15(6-3-13)25-12-21(27)28/h2,4,7-11,15,25H,3,5-6,12H2,1H3,(H,24,26)(H,27,28)

Standard InChI Key:  HUXIUBXCPRIWRC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   34.5649  -10.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5638  -10.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2786  -11.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9952  -10.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9924  -10.0808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2769   -9.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7053   -9.6656    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.8489  -11.3238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1347  -10.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2784  -12.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5641  -12.5595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5635  -13.3838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2785  -13.7973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.9926  -12.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9998  -13.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7806  -13.6221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2559  -12.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7688  -12.2978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0810  -12.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4965  -13.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3180  -13.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7280  -12.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3103  -12.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4826  -12.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5531  -12.9349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9693  -13.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7944  -13.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2107  -14.3554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2032  -12.9263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  2  8  1  0
  8  9  1  0
  3 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 15  1  0
 14 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 17 19  1  0
 19 20  1  0
 19 24  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H929 (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.43Molecular Weight (Monoisotopic): 395.1645AlogP: 3.99#Rotatable Bonds: 6
Polar Surface Area: 87.24Molecular Species: ZWITTERIONHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 2.07CX Basic pKa: 10.59CX LogP: 0.57CX LogD: 0.57
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -0.13

References

1. Tong Y, Florjancic AS, Clark RF, Lai C, Mastracchio A, Zhu GD, Smith ML, Kovar PJ, Shaw B, Albert DH, Qiu W, Longenecker KL, Liu X, Olson AM, Osterling DJ, Tahir SK, Phillips DC, Leverson JD, Souers AJ, Penning TD..  (2021)  Balancing Properties with Carboxylates: A Lead Optimization Campaign for Selective and Orally Active CDK9 Inhibitors.,  12  (7.0): [PMID:34267880] [10.1021/acsmedchemlett.1c00161]

Source