The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-[(3-Chloro-6,7,10,11-tetrahydro-9-methyl-7,11-methanocycloocta[b]quinolin-12-yl)amino]-N-[(2-methoxy-4-pyridyl)methyl]nonanamide ID: ALA4872514
PubChem CID: 164623019
Max Phase: Preclinical
Molecular Formula: C33H41ClN4O2
Molecular Weight: 561.17
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)CCCCCCCCNc2c3c(nc4cc(Cl)ccc24)CC2C=C(C)CC3C2)ccn1
Standard InChI: InChI=1S/C33H41ClN4O2/c1-22-15-24-17-25(16-22)32-29(18-24)38-28-20-26(34)10-11-27(28)33(32)36-13-8-6-4-3-5-7-9-30(39)37-21-23-12-14-35-31(19-23)40-2/h10-12,14-15,19-20,24-25H,3-9,13,16-18,21H2,1-2H3,(H,36,38)(H,37,39)
Standard InChI Key: REJJQNQSWRYGAY-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
22.7830 -27.1537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4909 -25.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7756 -25.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0630 -25.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0660 -26.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9369 -27.5690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9351 -25.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6504 -26.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6512 -27.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3665 -27.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0816 -27.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0767 -26.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3608 -25.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9330 -25.0910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2192 -27.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2216 -26.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7875 -26.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5032 -27.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3467 -25.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6465 -24.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6444 -23.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3578 -23.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3558 -22.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0692 -22.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0671 -21.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7806 -20.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7785 -20.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4920 -19.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4899 -18.9011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7976 -27.5579 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.2074 -20.1368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2033 -18.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2013 -17.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9145 -17.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9128 -16.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1968 -16.0171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4810 -16.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4862 -17.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7640 -16.0277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7640 -15.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
2 3 1 0
3 4 1 0
4 5 2 0
15 6 1 0
6 9 2 0
8 7 2 0
7 16 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 1 0
15 16 2 0
15 18 1 0
16 2 1 0
2 17 1 0
17 1 1 0
1 18 1 0
4 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
11 30 1 0
28 31 2 0
29 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
37 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.17Molecular Weight (Monoisotopic): 560.2918AlogP: 7.75#Rotatable Bonds: 13Polar Surface Area: 76.14Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.96CX LogP: 6.56CX LogD: 5.92Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -0.58
References 1. Pont C, Ginex T, Griñán-Ferré C, Scheiner M, Mattellone A, Martínez N, Arce EM, Soriano-Fernández Y, Naldi M, De Simone A, Barenys M, Gómez-Catalán J, Pérez B, Sabate R, Andrisano V, Loza MI, Brea J, Bartolini M, Bolognesi ML, Decker M, Pallàs M, Luque FJ, Muñoz-Torrero D.. (2021) From virtual screening hits targeting a cryptic pocket in BACE-1 to a nontoxic brain permeable multitarget anti-Alzheimer lead with disease-modifying and cognition-enhancing effects., 225 [PMID:34418785 ] [10.1016/j.ejmech.2021.113779 ]