3-Bromo-N-(2-((2-oxo-2-(((S)-1-phenylethyl)amino)ethyl)thio)benzo[d]thiazol-6-yl)-4-(pentan-2-yloxy)benzamide

ID: ALA4872578

PubChem CID: 164623064

Max Phase: Preclinical

Molecular Formula: C29H30BrN3O3S2

Molecular Weight: 612.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)cc1Br

Standard InChI:  InChI=1S/C29H30BrN3O3S2/c1-4-8-18(2)36-25-14-11-21(15-23(25)30)28(35)32-22-12-13-24-26(16-22)38-29(33-24)37-17-27(34)31-19(3)20-9-6-5-7-10-20/h5-7,9-16,18-19H,4,8,17H2,1-3H3,(H,31,34)(H,32,35)/t18?,19-/m0/s1

Standard InChI Key:  RSPWYXKQBBLGFS-GGYWPGCISA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    2.5203  -18.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5192  -19.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2272  -19.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9410  -19.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9382  -18.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2254  -18.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2230  -17.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9336  -16.8408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5141  -16.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6467  -17.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3573  -16.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0703  -17.2472    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.7809  -16.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5292  -17.1633    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.8605  -16.0120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6634  -15.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0699  -16.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8875  -16.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2997  -15.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8841  -15.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0678  -15.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1210  -15.8402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5305  -16.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3518  -16.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7617  -17.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5823  -17.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9908  -16.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5770  -15.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7578  -15.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8122  -16.5492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6491  -18.0727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1228  -17.2638    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2226  -17.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0397  -17.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8158  -17.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4501  -17.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2673  -17.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9831  -15.1285    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  6
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 10 31  2  0
 23 32  2  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 34 36  1  0
 36 37  1  0
 28 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872578

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 612.62Molecular Weight (Monoisotopic): 611.0912AlogP: 7.85#Rotatable Bonds: 11
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.60CX Basic pKa: 1.07CX LogP: 7.59CX LogD: 7.59
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: -1.92

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source