1-(3-(3,5-dimethylphenyl)-5-(5-methyl-1H-benzo[d]imidazol-2-yl)pyridin-4-yl)piperidin-4-amine

ID: ALA4872591

PubChem CID: 164623072

Max Phase: Preclinical

Molecular Formula: C26H29N5

Molecular Weight: 411.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(-c2cncc(-c3nc4cc(C)ccc4[nH]3)c2N2CCC(N)CC2)c1

Standard InChI:  InChI=1S/C26H29N5/c1-16-4-5-23-24(13-16)30-26(29-23)22-15-28-14-21(19-11-17(2)10-18(3)12-19)25(22)31-8-6-20(27)7-9-31/h4-5,10-15,20H,6-9,27H2,1-3H3,(H,29,30)

Standard InChI Key:  HJIZPSICVCGBRT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   14.8937   -5.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8926   -6.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6048   -6.4535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3186   -6.0400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3157   -5.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6030   -4.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0230   -4.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7367   -5.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4465   -4.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4438   -3.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7255   -3.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0186   -3.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5990   -3.9923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3114   -3.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3109   -2.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5997   -2.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8873   -2.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8861   -3.5840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6003   -1.5293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7195   -2.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1596   -5.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1859   -4.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0961   -3.9923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4353   -5.1416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8842   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2925   -3.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8863   -3.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0678   -3.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6571   -3.8308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0698   -4.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6540   -2.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  6 13  1  0
 16 19  1  0
 11 20  1  0
  9 21  1  0
 22 23  2  0
 23 26  1  0
 25 24  1  0
 24 22  1  0
  1 22  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872591

    ---

Associated Targets(Human)

SSTR2 Tclin Somatostatin receptor 2 (1526 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.55Molecular Weight (Monoisotopic): 411.2423AlogP: 5.14#Rotatable Bonds: 3
Polar Surface Area: 70.83Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.43CX Basic pKa: 10.01CX LogP: 4.41CX LogD: 1.78
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -0.92

References

1. Ishida A, Okabe Y, Matsushita T, Sekiguchi T, Nishio T, Komagata T, Iwaki M, Miyata H, Katagi J, Naganawa A, Maruyama T, Imagawa A..  (2021)  Design, synthesis, and biological evaluation of novel somatostatin receptor subtype-2 agonists: Optimization for potency and risk mitigation of hERG and phospholipidosis.,  49  [PMID:34626901] [10.1016/j.bmc.2021.116424]

Source