The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tert-butyl 2-((6-(2-bromo-4-fluorophenyl)-5-(ethoxycarbonyl)-2-(thiazol-2-yl)-3,6-dihydropyrimidin-4-yl)methyl)-2,8-diazaspiro[4.5]decane-8-carboxylate ID: ALA4872598
PubChem CID: 164624336
Max Phase: Preclinical
Molecular Formula: C30H37BrFN5O4S
Molecular Weight: 662.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(CN2CCC3(CCN(C(=O)OC(C)(C)C)CC3)C2)NC(c2nccs2)=NC1c1ccc(F)cc1Br
Standard InChI: InChI=1S/C30H37BrFN5O4S/c1-5-40-27(38)23-22(17-36-12-8-30(18-36)9-13-37(14-10-30)28(39)41-29(2,3)4)34-25(26-33-11-15-42-26)35-24(23)20-7-6-19(32)16-21(20)31/h6-7,11,15-16,24H,5,8-10,12-14,17-18H2,1-4H3,(H,34,35)
Standard InChI Key: ACKJWPWOLRDSJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
33.5544 -11.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5585 -10.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8487 -11.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1276 -7.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7148 -8.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1174 -9.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9344 -9.1988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3471 -8.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9429 -7.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4274 -4.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4263 -5.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1343 -5.7065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8440 -5.2971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8412 -4.4744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1325 -4.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7196 -4.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7194 -3.2524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0120 -4.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3042 -4.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5966 -4.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7183 -5.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7176 -6.5228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1273 -3.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8354 -2.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8333 -2.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1238 -1.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4150 -2.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4206 -2.8511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5528 -5.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6396 -6.5147 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.4392 -6.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8467 -5.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2989 -5.3686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5439 -3.2519 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
32.1203 -0.8038 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.0597 -7.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3116 -7.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3819 -7.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3381 -9.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9246 -10.6142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1552 -9.9150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3761 -10.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 10 1 0
10 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
11 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
15 23 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
13 29 1 0
24 34 1 0
26 35 1 0
22 36 1 0
36 37 1 0
37 4 1 0
4 38 1 0
38 22 1 0
7 39 1 0
39 40 2 0
39 41 1 0
41 2 1 0
2 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 662.63Molecular Weight (Monoisotopic): 661.1734AlogP: 5.68#Rotatable Bonds: 6Polar Surface Area: 96.36Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.10CX LogP: 4.45CX LogD: 4.28Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.40Np Likeness Score: -1.32
References 1. Ma Y, Zhao S, Ren Y, Cherukupalli S, Li Q, Woodson ME, Bradley DP, Tavis JE, Liu X, Zhan P.. (2021) Design, synthesis and evaluation of heteroaryldihydropyrimidine analogues bearing spiro ring as hepatitis B virus capsid protein inhibitors., 225 [PMID:34438123 ] [10.1016/j.ejmech.2021.113780 ]