2-Fluoro-5-((4-phenylnaphthalene)-1-sulfonamido)benzoic acid

ID: ALA4872622

PubChem CID: 164623522

Max Phase: Preclinical

Molecular Formula: C23H16FNO4S

Molecular Weight: 421.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(NS(=O)(=O)c2ccc(-c3ccccc3)c3ccccc23)ccc1F

Standard InChI:  InChI=1S/C23H16FNO4S/c24-21-12-10-16(14-20(21)23(26)27)25-30(28,29)22-13-11-17(15-6-2-1-3-7-15)18-8-4-5-9-19(18)22/h1-14,25H,(H,26,27)

Standard InChI Key:  FILYSNGGEXLHEI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   21.3171   -4.9857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4999   -4.9857    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.9085   -5.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2125   -2.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2114   -3.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9194   -4.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6291   -3.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6263   -2.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9176   -2.5338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5034   -4.1702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7947   -5.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0928   -6.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7974   -6.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3804   -6.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3385   -4.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3398   -4.9864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0456   -3.7595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3324   -2.5278    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.3828   -5.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0873   -4.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0875   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3840   -3.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6789   -4.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6821   -4.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6726   -6.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9665   -6.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2592   -6.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2585   -7.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9711   -7.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6755   -7.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10  2  1  0
  2 11  1  0
 11 20  2  0
 14 12  1  0
 12 13  2  0
 13 11  1  0
 14 19  2  0
 15 16  1  0
 15 17  2  0
  7 15  1  0
  8 18  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 14 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872622

    ---

Associated Targets(Human)

FABP4 Tchem Fatty acid binding protein adipocyte (764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FABP5 Tchem Fatty acid binding protein epidermal (323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.45Molecular Weight (Monoisotopic): 421.0784AlogP: 5.14#Rotatable Bonds: 5
Polar Surface Area: 83.47Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.18CX Basic pKa: CX LogP: 4.90CX LogD: 1.29
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.30

References

1. He YL, Chen MT, Wang T, Zhang MM, Li YX, Wang HY, Ding N..  (2021)  Development of FABP4/5 inhibitors with potential therapeutic effect on type 2 Diabetes Mellitus.,  224  [PMID:34332399] [10.1016/j.ejmech.2021.113720]

Source