The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(3-(5,7-Dihydroxy-4-oxo-4H-chromen-2-yl)phenyl)-2-(furan-2-yl)-5,7-dihydroxy-4H-chromen-4-one ID: ALA4872638
PubChem CID: 164623535
Max Phase: Preclinical
Molecular Formula: C28H16O9
Molecular Weight: 496.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1cc(-c2cccc(-c3c(O)cc(O)c4c(=O)cc(-c5ccco5)oc34)c2)oc2cc(O)cc(O)c12
Standard InChI: InChI=1S/C28H16O9/c29-15-8-16(30)26-19(33)11-22(36-24(26)9-15)13-3-1-4-14(7-13)25-17(31)10-18(32)27-20(34)12-23(37-28(25)27)21-5-2-6-35-21/h1-12,29-32H
Standard InChI Key: CMJNWRXMGKHYFF-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
30.0737 -26.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0726 -27.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7847 -27.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7829 -26.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4916 -26.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4990 -27.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2075 -27.9130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9213 -27.4979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9179 -26.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2008 -26.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7805 -25.4523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3604 -27.9183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1963 -25.4421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6342 -27.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6323 -28.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3444 -29.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0561 -28.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0512 -27.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3385 -27.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3462 -29.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6360 -30.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6375 -31.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3508 -31.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0591 -30.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0605 -31.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7649 -31.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4723 -31.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4709 -30.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7620 -29.9509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7652 -32.4050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3558 -32.4197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9239 -29.9578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1791 -29.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9256 -30.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4725 -29.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0640 -28.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2647 -29.1384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
4 11 1 0
2 12 1 0
10 13 2 0
8 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 25 1 0
24 20 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
26 30 2 0
23 31 1 0
21 32 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 33 1 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.43Molecular Weight (Monoisotopic): 496.0794AlogP: 5.32#Rotatable Bonds: 3Polar Surface Area: 154.48Molecular Species: ACIDHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.19CX Basic pKa: ┄CX LogP: 4.75CX LogD: 2.79Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: 0.71
References 1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H.. (2021) Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer., 64 (16.0): [PMID:34404206 ] [10.1021/acs.jmedchem.1c00735 ]