The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cyclobutyl(4-((1-(3-methylbenzyl)-1H-benzo[d]imidazol-2-yl)methyl)piperazin-1-yl)methanone ID: ALA4872656
PubChem CID: 164623545
Max Phase: Preclinical
Molecular Formula: C25H30N4O
Molecular Weight: 402.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(Cn2c(CN3CCN(C(=O)C4CCC4)CC3)nc3ccccc32)c1
Standard InChI: InChI=1S/C25H30N4O/c1-19-6-4-7-20(16-19)17-29-23-11-3-2-10-22(23)26-24(29)18-27-12-14-28(15-13-27)25(30)21-8-5-9-21/h2-4,6-7,10-11,16,21H,5,8-9,12-15,17-18H2,1H3
Standard InChI Key: OGOLJWXYDGYEAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
21.9315 -28.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9304 -29.3144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6452 -29.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6433 -28.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3587 -28.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3635 -29.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1511 -29.5606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6329 -28.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1432 -28.2235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3936 -27.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8379 -26.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0911 -26.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5363 -25.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7295 -25.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4803 -26.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0369 -27.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7870 -24.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4579 -28.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8662 -28.1673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6954 -28.1690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1037 -27.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6905 -26.7418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8645 -26.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4518 -27.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1015 -26.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9265 -26.0247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6874 -25.3129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5094 -26.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0915 -26.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5068 -25.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
13 17 1 0
8 18 1 0
18 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2420AlogP: 3.84#Rotatable Bonds: 5Polar Surface Area: 41.37Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.36CX LogP: 4.03CX LogD: 4.03Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.89
References 1. Ma Z, Jiang L, Li B, Liang D, Feng Y, Liu L, Jiang C.. (2021) Discovery of benzimidazole derivatives as potent and selective aldehyde dehydrogenase 1A1 (ALDH1A1) inhibitors with glucose consumption improving activity., 46 [PMID:34403955 ] [10.1016/j.bmc.2021.116352 ]