5-Chloro-N2-phenethyl-N4-(3-(trifiuoromethyl)phenyl)pyrimidine-2,4-diamine

ID: ALA4872742

PubChem CID: 164621600

Max Phase: Preclinical

Molecular Formula: C20H18ClF3N4

Molecular Weight: 406.84

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  FC(F)(F)c1cccc(Nc2nc(NCCCc3ccccc3)ncc2Cl)c1

Standard InChI:  InChI=1S/C20H18ClF3N4/c21-17-13-26-19(25-11-5-8-14-6-2-1-3-7-14)28-18(17)27-16-10-4-9-15(12-16)20(22,23)24/h1-4,6-7,9-10,12-13H,5,8,11H2,(H2,25,26,27,28)

Standard InChI Key:  BDJBQDWXWDLZTM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    5.6859   -3.0871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6848   -3.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928   -4.3156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1025   -3.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0996   -3.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3910   -2.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8058   -2.6723    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.8108   -4.3137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5179   -3.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2229   -4.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9295   -3.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9286   -3.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2153   -2.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5117   -3.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9767   -4.3147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2693   -3.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6376   -4.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6385   -5.1279    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0403   -3.5989    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4531   -4.3088    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.2700   -3.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5626   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8604   -3.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1565   -2.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4547   -3.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4566   -3.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1662   -4.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8651   -3.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  1  0
 15 16  1  0
 11 17  1  0
 17 18  1  0
 17 19  1  0
 17 20  1  0
 16 21  1  0
 21 22  1  0
 23 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872742

    ---

Associated Targets(Human)

CTSC Tchem Dipeptidyl peptidase I (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.84Molecular Weight (Monoisotopic): 406.1172AlogP: 5.94#Rotatable Bonds: 7
Polar Surface Area: 49.84Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.51CX LogP: 6.18CX LogD: 6.17
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -1.55

References

1. Chen X, Yan Y, Zhang Z, Zhang F, Liu M, Du L, Zhang H, Shen X, Zhao D, Shi JB, Liu X..  (2021)  Discovery and In Vivo Anti-inflammatory Activity Evaluation of a Novel Non-peptidyl Non-covalent Cathepsin C Inhibitor.,  64  (16.0): [PMID:34374541] [10.1021/acs.jmedchem.1c00104]

Source