4-(furan-2-yl)-N-isopropyl-6-(trifluoromethyl)pyrimidin-2-amine

ID: ALA4872744

PubChem CID: 164623943

Max Phase: Preclinical

Molecular Formula: C12H12F3N3O

Molecular Weight: 271.24

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Nc1nc(-c2ccco2)cc(C(F)(F)F)n1

Standard InChI:  InChI=1S/C12H12F3N3O/c1-7(2)16-11-17-8(9-4-3-5-19-9)6-10(18-11)12(13,14)15/h3-7H,1-2H3,(H,16,17,18)

Standard InChI Key:  IBYSXSBYOAYQIR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
    7.2392  -11.7750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.0316  -11.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8212  -11.1960    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.3115  -14.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0175  -14.4488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7288  -14.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7343  -13.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0283  -12.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3169  -13.2137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6001  -14.4394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8942  -14.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1848  -14.1284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4348  -14.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5154  -15.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3152  -15.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7315  -14.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7442  -11.5881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1828  -14.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9017  -13.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  4 10  1  0
  8  2  1  0
 10 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 12 16  1  0
  6 13  1  0
  2 17  1  0
 11 18  1  0
 11 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872744

    ---

Associated Targets(Human)

TLR8 Tchem Toll-like receptor 8 (1853 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 271.24Molecular Weight (Monoisotopic): 271.0932AlogP: 3.58#Rotatable Bonds: 3
Polar Surface Area: 50.95Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.32CX LogP: 3.33CX LogD: 3.33
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.93Np Likeness Score: -1.74

References

1. Dolšak A, Šribar D, Scheffler A, Grabowski M, Švajger U, Gobec S, Holze J, Weindl G, Wolber G, Sova M..  (2021)  Further hit optimization of 6-(trifluoromethyl)pyrimidin-2-amine based TLR8 modulators: Synthesis, biological evaluation and structure-activity relationships.,  225  [PMID:34488023] [10.1016/j.ejmech.2021.113809]

Source