The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(aminomethyl)phenyl)-N-(5-((4-cyanophenyl)(cyclopropylmethylamino)methyl)-2-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA4872758
PubChem CID: 118355582
Max Phase: Preclinical
Molecular Formula: C30H26F4N6O
Molecular Weight: 562.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(C(NCC2CC2)c2ccc(F)c(NC(=O)c3cc(C(F)(F)F)nn3-c3cccc(CN)c3)c2)cc1
Standard InChI: InChI=1S/C30H26F4N6O/c31-24-11-10-22(28(37-17-19-4-5-19)21-8-6-18(15-35)7-9-21)13-25(24)38-29(41)26-14-27(30(32,33)34)39-40(26)23-3-1-2-20(12-23)16-36/h1-3,6-14,19,28,37H,4-5,16-17,36H2,(H,38,41)
Standard InChI Key: GLPWOIBPISJWCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
22.5983 -14.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5971 -15.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3119 -15.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0283 -15.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0255 -14.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3101 -14.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7434 -15.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4572 -15.2536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3076 -13.1912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9677 -12.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7104 -11.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8854 -11.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6329 -12.7073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3984 -11.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7316 -10.5013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.5782 -11.3447 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8080 -10.6665 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.7537 -12.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9297 -13.7598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3637 -12.3985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1497 -12.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3225 -13.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1076 -13.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7186 -13.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5391 -12.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7541 -12.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5740 -11.2868 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2832 -14.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6730 -15.0653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0692 -14.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2429 -15.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0279 -15.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6392 -15.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4600 -14.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6752 -14.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8486 -15.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2384 -16.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4340 -16.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9891 -17.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4255 -15.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2118 -15.7575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
10 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
23 28 1 0
28 29 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
29 36 1 0
36 37 1 0
38 37 1 0
39 38 1 0
37 39 1 0
40 41 3 0
33 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.57Molecular Weight (Monoisotopic): 562.2104AlogP: 5.70#Rotatable Bonds: 9Polar Surface Area: 108.76Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.35CX Basic pKa: 9.30CX LogP: 5.58CX LogD: 2.80Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -1.72
References 1. Kotian PL, Wu M, Vadlakonda S, Chintareddy V, Lu P, Juarez L, Kellogg-Yelder D, Chen X, Muppa S, Chambers-Wilson R, Davis Parker C, Williams J, Polach KJ, Zhang W, Raman K, Babu YS.. (2021) Berotralstat (BCX7353): Structure-Guided Design of a Potent, Selective, and Oral Plasma Kallikrein Inhibitor to Prevent Attacks of Hereditary Angioedema (HAE)., 64 (17.0): [PMID:34436898 ] [10.1021/acs.jmedchem.1c00511 ]