5-(2-amino-5-(2-fluoro-5-nitrophenyl)pyridin-3-yl)-2-hydroxybenzonitrile

ID: ALA4872804

PubChem CID: 122588224

Max Phase: Preclinical

Molecular Formula: C18H11FN4O3

Molecular Weight: 350.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cc(-c2cc(-c3cc([N+](=O)[O-])ccc3F)cnc2N)ccc1O

Standard InChI:  InChI=1S/C18H11FN4O3/c19-16-3-2-13(23(25)26)7-14(16)12-6-15(18(21)22-9-12)10-1-4-17(24)11(5-10)8-20/h1-7,9,24H,(H2,21,22)

Standard InChI Key:  UQABCQIUSYAXIO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   11.6562  -13.8088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3643  -13.3970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6562  -14.6282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9476  -13.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6580   -8.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3660   -8.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3686  -10.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6580   -9.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9458  -10.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2375   -9.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5330  -10.1280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5330  -10.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2350  -11.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9458  -10.9489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2350  -12.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2375   -8.8976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5257  -12.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5253  -13.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2355  -13.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9444  -12.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8186  -12.1712    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.0743   -8.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0745   -9.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7824   -8.4883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7837  -10.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4866  -10.5203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  2  0
  1  3  1  0
  6  5  2  0
 22  6  1  0
  7 23  1  0
  8  7  2  0
  5  8  1  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 15 13  1  0
 10 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19  4  1  0
  4 20  2  0
 20 15  1  0
 17 21  1  0
 22 23  2  0
 22 24  1  0
 23 25  1  0
 25 26  3  0
M  CHG  2   1   1   3  -1
M  END

Alternative Forms

  1. Parent:

    ALA4872804

    ---

Associated Targets(Human)

STK4 Tchem Serine/threonine-protein kinase MST1 (2643 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 350.31Molecular Weight (Monoisotopic): 350.0815AlogP: 3.62#Rotatable Bonds: 3
Polar Surface Area: 126.07Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.62CX Basic pKa: 5.81CX LogP: 3.33CX LogD: 3.23
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.55Np Likeness Score: -0.97

References

1.  (2020)  STK4 inhibitors for treatment of hematologic malignancies, 

Source