The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3,6-Dihydro-2H-pyran-4-yl)-2-methoxy-N-(5-(3-(pyrrolidin-1-ylmethyl)phenyl)pyridin-3-yl)pyridine-3-sulfonamide ID: ALA4872822
PubChem CID: 164619469
Max Phase: Preclinical
Molecular Formula: C27H30N4O4S
Molecular Weight: 506.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncc(C2=CCOCC2)cc1S(=O)(=O)Nc1cncc(-c2cccc(CN3CCCC3)c2)c1
Standard InChI: InChI=1S/C27H30N4O4S/c1-34-27-26(15-24(17-29-27)21-7-11-35-12-8-21)36(32,33)30-25-14-23(16-28-18-25)22-6-4-5-20(13-22)19-31-9-2-3-10-31/h4-7,13-18,30H,2-3,8-12,19H2,1H3
Standard InChI Key: JPVVZXICAFFNMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
8.8109 -26.4876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8390 -25.8261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5770 -25.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2680 -25.8941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0031 -25.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0415 -24.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3506 -24.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6178 -24.6232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9228 -24.1749 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6085 -24.7016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2229 -24.1033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9606 -23.3523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2691 -22.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3074 -22.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6131 -21.6330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8799 -22.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8416 -22.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5359 -23.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1070 -23.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4126 -22.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6793 -23.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6451 -23.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3361 -24.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2956 -25.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5783 -25.6459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0670 -24.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7772 -24.3171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4715 -24.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2069 -24.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2435 -23.5622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5491 -23.1144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8162 -23.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8259 -25.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2682 -25.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6713 -26.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4781 -26.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 2 0
9 11 2 0
9 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 2 0
26 19 1 0
6 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 27 1 0
25 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.63Molecular Weight (Monoisotopic): 506.1988AlogP: 4.35#Rotatable Bonds: 8Polar Surface Area: 93.65Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.15CX Basic pKa: 9.33CX LogP: 1.45CX LogD: 1.29Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.49Np Likeness Score: -1.24
References 1. Down K, Amour A, Anderson NA, Barton N, Campos S, Cannons EP, Clissold C, Convery MA, Coward JJ, Doyle K, Duempelfeld B, Edwards CD, Goldsmith MD, Krause J, Mallett DN, McGonagle GA, Patel VK, Rowedder J, Rowland P, Sharpe A, Sriskantharajah S, Thomas DA, Thomson DW, Uddin S, Hamblin JN, Hessel EM.. (2021) Discovery of GSK251: A Highly Potent, Highly Selective, Orally Bioavailable Inhibitor of PI3Kδ with a Novel Binding Mode., 64 (18.0): [PMID:34510892 ] [10.1021/acs.jmedchem.1c01102 ]