The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-amino-5-((2S,3S)-1-((S)-1-((2R,3S)-1-(cycloheptylamino)-2-hydroxy-5-methylhexan-3-ylamino)-1-oxo-3-(thiophen-2-yl)propan-2-ylamino)-3-methyl-1-oxopentan-2-ylamino)-5-oxopentanoic acid ID: ALA4872824
PubChem CID: 164624347
Max Phase: Preclinical
Molecular Formula: C32H55N5O6S
Molecular Weight: 637.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](Cc1cccs1)C(=O)N[C@@H](CC(C)C)[C@H](O)CNC1CCCCCC1
Standard InChI: InChI=1S/C32H55N5O6S/c1-5-21(4)29(37-30(41)24(33)14-15-28(39)40)32(43)36-26(18-23-13-10-16-44-23)31(42)35-25(17-20(2)3)27(38)19-34-22-11-8-6-7-9-12-22/h10,13,16,20-22,24-27,29,34,38H,5-9,11-12,14-15,17-19,33H2,1-4H3,(H,35,42)(H,36,43)(H,37,41)(H,39,40)/t21-,24-,25-,26-,27+,29-/m0/s1
Standard InChI Key: OTDZNXZCJNMAGP-AAMRELFESA-N
Molfile:
RDKit 2D
44 45 0 0 0 0 0 0 0 0999 V2000
27.5564 -13.9123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2709 -13.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9789 -13.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6934 -13.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2645 -13.4998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6934 -12.6748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4078 -13.9123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1224 -13.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8369 -13.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5513 -13.4998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2658 -13.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9802 -13.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6947 -13.9123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4091 -13.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1236 -13.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9789 -14.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2645 -15.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2645 -15.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5500 -16.3873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9789 -16.3873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1224 -12.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8369 -12.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8369 -11.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4078 -12.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2658 -14.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8369 -14.7373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9802 -12.6748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1236 -14.7373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9802 -15.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0709 -15.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8778 -16.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2903 -15.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7382 -14.8124 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.4091 -12.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8380 -13.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1914 -11.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3939 -11.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7732 -11.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7454 -13.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0300 -12.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5941 -12.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9541 -13.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2099 -12.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7911 -12.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 4 1 0
3 5 1 0
4 6 2 0
4 7 1 0
8 7 1 1
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
3 16 1 6
16 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
8 21 1 0
21 22 1 0
22 23 1 0
21 24 1 1
11 25 1 6
9 26 2 0
12 27 2 0
15 28 1 1
25 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 1 0
14 34 1 1
15 35 1 0
35 1 1 0
34 36 1 0
36 37 1 0
36 38 1 0
39 40 1 0
40 41 1 0
39 42 1 0
2 43 1 0
43 44 1 0
44 41 1 0
42 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 637.89Molecular Weight (Monoisotopic): 637.3873AlogP: 2.70#Rotatable Bonds: 19Polar Surface Area: 182.88Molecular Species: ZWITTERIONHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.22CX Basic pKa: 10.20CX LogP: 0.69CX LogD: -0.05Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.11Np Likeness Score: 0.15
References 1. Kobayashi K, Otani T, Ijiri S, Kawasaki Y, Matsubara H, Miyagi T, Kitajima T, Iseki R, Ishizawa K, Shindo N, Okawa K, Ueda K, Ando S, Kawakita M, Hattori Y, Akaji K.. (2021) Structure-activity relationship study of hydroxyethylamine isostere and P1' site structure of peptide mimetic BACE1 inhibitors., 50 [PMID:34700240 ] [10.1016/j.bmc.2021.116459 ]