The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 6-((7-benzyl-6,8-dioxo-2,7-diazaspiro[4.4]nonan-2-yl)methyl)-4-(2-bromo-4-fluorophenyl)-2-(thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate ID: ALA4872833
PubChem CID: 164624355
Max Phase: Preclinical
Molecular Formula: C31H29BrFN5O4S
Molecular Weight: 666.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(CN2CCC3(CC(=O)N(Cc4ccccc4)C3=O)C2)NC(c2nccs2)=NC1c1ccc(F)cc1Br
Standard InChI: InChI=1S/C31H29BrFN5O4S/c1-2-42-29(40)25-23(35-27(28-34-11-13-43-28)36-26(25)21-9-8-20(33)14-22(21)32)17-37-12-10-31(18-37)15-24(39)38(30(31)41)16-19-6-4-3-5-7-19/h3-9,11,13-14,26H,2,10,12,15-18H2,1H3,(H,35,36)
Standard InChI Key: IXJBRAOIAPGDQW-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
22.5747 -20.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3601 -21.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0435 -21.6495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6806 -21.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3908 -20.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8758 -17.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8747 -17.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5827 -18.3317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2924 -17.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2895 -17.0996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5809 -16.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1680 -16.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1678 -15.8776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4604 -17.1035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7526 -16.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0450 -17.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1666 -18.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1660 -19.1480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5757 -15.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2838 -15.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2817 -14.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5722 -14.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8634 -14.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8690 -15.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0012 -18.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0880 -19.1399 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.8876 -19.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2951 -18.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7472 -17.9938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9923 -15.8771 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
23.5687 -13.4290 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.5044 -19.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7564 -20.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8266 -19.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5960 -21.4916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4691 -21.3525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0830 -22.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3958 -22.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6719 -22.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9852 -22.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0243 -23.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7559 -24.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4395 -23.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 1 0
6 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
7 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
11 19 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 2 0
9 25 1 0
20 30 1 0
22 31 1 0
18 32 1 0
32 33 1 0
33 1 1 0
1 34 1 0
34 18 1 0
2 35 2 0
4 36 2 0
3 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 666.57Molecular Weight (Monoisotopic): 665.1108AlogP: 4.60#Rotatable Bonds: 8Polar Surface Area: 104.20Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.40CX LogP: 3.98CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.28Np Likeness Score: -1.26
References 1. Ma Y, Zhao S, Ren Y, Cherukupalli S, Li Q, Woodson ME, Bradley DP, Tavis JE, Liu X, Zhan P.. (2021) Design, synthesis and evaluation of heteroaryldihydropyrimidine analogues bearing spiro ring as hepatitis B virus capsid protein inhibitors., 225 [PMID:34438123 ] [10.1016/j.ejmech.2021.113780 ]