2,4-Dichloro-N-(3-(N-phenylsulfamoyl)phenyl)benzamide

ID: ALA4872873

PubChem CID: 164624369

Max Phase: Preclinical

Molecular Formula: C19H14Cl2N2O3S

Molecular Weight: 421.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(S(=O)(=O)Nc2ccccc2)c1)c1ccc(Cl)cc1Cl

Standard InChI:  InChI=1S/C19H14Cl2N2O3S/c20-13-9-10-17(18(21)11-13)19(24)22-15-7-4-8-16(12-15)27(25,26)23-14-5-2-1-3-6-14/h1-12,23H,(H,22,24)

Standard InChI Key:  LMTUDYOSBKTKSF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   18.4735  -11.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0690  -10.3635    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.6600  -11.0666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5356   -9.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8265  -10.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1174   -9.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4124  -10.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4124  -11.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1174  -11.5932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8265  -11.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5356   -9.1416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2405  -10.3674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9496   -9.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6587  -10.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3637   -9.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3637   -9.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6587   -8.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9496   -9.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7033  -11.5932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.1174   -9.1416    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.7791   -9.9576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4871  -10.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4826  -11.1817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1898  -11.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8981  -11.1804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8948  -10.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1870   -9.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  2  0
  4 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 12 13  1  0
  8 19  1  0
  6 20  1  0
 15  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872873

    ---

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.31Molecular Weight (Monoisotopic): 420.0102AlogP: 5.05#Rotatable Bonds: 5
Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 4.76CX LogD: 4.62
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.61Np Likeness Score: -2.07

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source