7-Fluoro-12-(((5-fluoro-2,3-dthydrobenzofuran-4-yl)methyl)-amino)-4,5-dihydro-3H-2,4,11,12a-tetroazabenzo[4,5]cycloocta-[1,2,3-cd]inden-3-one

ID: ALA4872891

PubChem CID: 164619484

Max Phase: Preclinical

Molecular Formula: C23H19F2N5O2

Molecular Weight: 435.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1NCc2cc(F)ccc2C2=CN=C(NCc3c(F)ccc4c3CCO4)N3C=NC1C23

Standard InChI:  InChI=1S/C23H19F2N5O2/c24-13-1-2-14-12(7-13)8-26-22(31)20-21-17(14)10-28-23(30(21)11-29-20)27-9-16-15-5-6-32-19(15)4-3-18(16)25/h1-4,7,10-11,20-21H,5-6,8-9H2,(H,26,31)(H,27,28)

Standard InChI Key:  XQPYRSVDYFAUIM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   24.7799  -11.7577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0429  -11.3952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3582  -11.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8321  -12.5767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1944  -13.8459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4742  -13.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4595  -11.3039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1923  -11.6656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8719  -11.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2290  -10.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4913   -9.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8152  -10.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2818  -11.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6051  -11.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8229  -12.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6344  -12.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9179  -11.6269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0809  -10.0410    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.4320  -12.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4681  -14.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1894  -14.7636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9788  -14.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3791  -13.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1534  -13.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2423  -13.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6428  -12.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2149  -12.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3866  -12.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9880  -12.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4183  -13.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4871  -15.1777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1711  -12.9120    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 19  3  2  0
  4  1  1  0
  1  2  2  0
  2  3  1  0
  4 24  1  0
 23  5  1  0
  5  6  2  0
  6  4  1  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  9 14  2  0
 13 10  2  0
 10 11  1  0
 11 12  2  0
 12  9  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 12 18  1  0
 26 19  1  0
 25 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 22 31  2  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872891

    ---

Associated Targets(Human)

KARPAS-422 (454 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EED Tchem Polycomb protein EED (645 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.43Molecular Weight (Monoisotopic): 435.1507AlogP: 2.11#Rotatable Bonds: 2
Polar Surface Area: 78.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.77CX Basic pKa: 8.34CX LogP: 2.04CX LogD: 1.07
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.76Np Likeness Score: -0.05

References

1. Rej RK, Wang C, Lu J, Wang M, Petrunak E, Zawacki KP, McEachern D, Yang CY, Wang L, Li R, Chinnaswamy K, Wen B, Sun D, Stuckey JA, Zhou Y, Chen J, Tang G, Wang S..  (2021)  Discovery of EEDi-5273 as an Exceptionally Potent and Orally Efficacious EED Inhibitor Capable of Achieving Complete and Persistent Tumor Regression.,  64  (19.0): [PMID:34613724] [10.1021/acs.jmedchem.1c01059]

Source