4-((4-(tert-Butyl)phenyl)sulfonyl)-5-methyl-1-(2,4,5-trimethoxyphenyl)-1H-1,2,3-triazole

ID: ALA4872907

PubChem CID: 130471919

Max Phase: Preclinical

Molecular Formula: C22H27N3O5S

Molecular Weight: 445.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(OC)c(-n2nnc(S(=O)(=O)c3ccc(C(C)(C)C)cc3)c2C)cc1OC

Standard InChI:  InChI=1S/C22H27N3O5S/c1-14-21(31(26,27)16-10-8-15(9-11-16)22(2,3)4)23-24-25(14)17-12-19(29-6)20(30-7)13-18(17)28-5/h8-13H,1-7H3

Standard InChI Key:  KUWFOILULGFGAF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   19.8066   -5.1095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0967   -4.6968    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.0957   -5.5164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8442   -3.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8431   -4.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5553   -4.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2690   -4.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2662   -3.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5535   -2.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9775   -4.4273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0642   -5.2440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8680   -5.4127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2755   -4.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7235   -4.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5550   -5.2525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8431   -5.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8962   -3.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5065   -3.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3284   -3.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7340   -3.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3225   -2.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4970   -2.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0909   -3.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7272   -1.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5485   -1.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3148   -1.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1355   -1.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5510   -1.9684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2575   -1.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1360   -2.7908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1351   -1.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  7 10  1  0
  6 15  1  0
 15 16  1  0
 14 17  1  0
 13  2  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  9 28  1  0
 28 29  1  0
  4 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872907

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.54Molecular Weight (Monoisotopic): 445.1671AlogP: 3.73#Rotatable Bonds: 6
Polar Surface Area: 92.54Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.50CX LogD: 4.50
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -1.40

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source