The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((1-((2-chloro-6-methylquinolin-3-yl)methyl)-1H-1,2,3-triazol-4-yl)methyl)-1-phenyl-1H-1,2,4-triazol-5(4H)-one ID: ALA4872920
PubChem CID: 164624378
Max Phase: Preclinical
Molecular Formula: C22H18ClN7O
Molecular Weight: 431.89
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc(Cl)c(Cn3cc(Cn4cnn(-c5ccccc5)c4=O)nn3)cc2c1
Standard InChI: InChI=1S/C22H18ClN7O/c1-15-7-8-20-16(9-15)10-17(21(23)25-20)11-29-13-18(26-27-29)12-28-14-24-30(22(28)31)19-5-3-2-4-6-19/h2-10,13-14H,11-12H2,1H3
Standard InChI Key: DAIBLQZCOYXYJU-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
33.2310 -11.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2299 -12.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9379 -12.5577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9361 -10.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6448 -11.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6455 -12.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3541 -12.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0623 -12.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0576 -11.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3485 -10.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5184 -12.5550 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.5232 -10.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8156 -11.3295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0718 -10.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5252 -11.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9340 -12.3141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7332 -12.1438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7124 -11.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2323 -12.1824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4187 -12.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1663 -12.9631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8276 -13.4433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4885 -12.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9369 -11.5258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3892 -13.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7838 -12.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0073 -12.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8369 -13.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4493 -14.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2234 -14.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7628 -10.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
2 11 1 0
1 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 19 1 0
20 24 2 0
21 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
9 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.89Molecular Weight (Monoisotopic): 431.1261AlogP: 3.23#Rotatable Bonds: 5Polar Surface Area: 83.42Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.84CX LogP: 4.57CX LogD: 4.57Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.83
References 1. Nesaragi AR, Kamble RR, Bayannavar PK, Shaikh SKJ, Hoolageri SR, Kodasi B, Joshi SD, Kumbar VM.. (2021) Microwave assisted regioselective synthesis of quinoline appended triazoles as potent anti-tubercular and antifungal agents via copper (I) catalyzed cycloaddition., 41 [PMID:33766768 ] [10.1016/j.bmcl.2021.127984 ]