(+/-)-Radulapin B

ID: ALA4872940

PubChem CID: 164619492

Max Phase: Preclinical

Molecular Formula: C38H40O4

Molecular Weight: 560.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=CC2c3c(CCc4ccccc4)cc(O)cc3OC(c3c(O)cc(O)cc3CCc3ccccc3)C2C(C)(C)C1

Standard InChI:  InChI=1S/C38H40O4/c1-24-18-31-34-27(16-14-25-10-6-4-7-11-25)19-30(40)22-33(34)42-37(36(31)38(2,3)23-24)35-28(20-29(39)21-32(35)41)17-15-26-12-8-5-9-13-26/h4-13,18-22,31,36-37,39-41H,14-17,23H2,1-3H3

Standard InChI Key:  PKJNQYKSGHMPCP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
   19.5466   -3.7310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1421   -4.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9591   -4.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5830   -3.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5819   -4.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2899   -4.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2881   -2.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9967   -3.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9955   -4.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7080   -2.8141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8752   -2.8232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2896   -5.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5818   -5.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5815   -6.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8728   -6.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8722   -7.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5803   -8.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2905   -7.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2876   -6.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4171   -3.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1192   -2.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8286   -3.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5344   -2.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5321   -1.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8181   -1.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1152   -1.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4198   -4.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7023   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7105   -5.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4347   -5.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1522   -5.2775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4050   -1.5928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2379   -1.5785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4417   -6.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8305   -4.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5392   -4.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5411   -5.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8338   -5.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8354   -6.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5446   -6.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2537   -6.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2486   -5.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 10  1  0
  9 28  1  0
  4 11  1  0
  6 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 20  1  0
 20 27  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 20 21  1  0
 27 28  1  0
 27  2  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31  2  1  0
 26 32  1  0
 24 33  1  0
 30 34  1  0
 22 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872940

    ---

Associated Targets(Human)

PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.73Molecular Weight (Monoisotopic): 560.2927AlogP: 8.58#Rotatable Bonds: 7
Polar Surface Area: 69.92Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.94CX Basic pKa: CX LogP: 9.79CX LogD: 9.78
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.20Np Likeness Score: 1.36

References

1. Zhang CY, Gao Y, Zhou JC, Xu ZJ, Qiao YN, Zhang JZ, Lou HX..  (2021)  Diverse Prenylated Bibenzyl Enantiomers from the Chinese Liverwort Radula apiculata and Their Cytotoxic Activities.,  84  (5.0): [PMID:33913326] [10.1021/acs.jnatprod.0c01264]

Source