The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(1-(2-((4-methyl-3-(trifluoromethyl)phenyl)amino)-2-oxoethyl)-1H-pyrazol-4-yl)-1H-indazol-3-yl)nicotinamide ID: ALA4872941
PubChem CID: 164619493
Max Phase: Preclinical
Molecular Formula: C26H20F3N7O2
Molecular Weight: 519.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Cn2cc(-c3ccc4c(NC(=O)c5cccnc5)n[nH]c4c3)cn2)cc1C(F)(F)F
Standard InChI: InChI=1S/C26H20F3N7O2/c1-15-4-6-19(10-21(15)26(27,28)29)32-23(37)14-36-13-18(12-31-36)16-5-7-20-22(9-16)34-35-24(20)33-25(38)17-3-2-8-30-11-17/h2-13H,14H2,1H3,(H,32,37)(H2,33,34,35,38)
Standard InChI Key: LNSYNFKGAXNAKD-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
3.7638 -12.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4734 -11.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4706 -10.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7620 -10.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0557 -11.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0569 -10.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2807 -10.6206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7997 -11.2805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2788 -11.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0251 -12.7185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1768 -10.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9223 -10.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4668 -10.1781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0555 -9.4719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2569 -9.6449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2799 -10.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6151 -11.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4281 -11.0881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1372 -11.6686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7633 -11.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2820 -12.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6165 -13.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4304 -13.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9086 -12.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5714 -11.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1384 -13.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3254 -13.8190 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4732 -14.6472 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5528 -14.4783 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5710 -13.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3173 -14.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3706 -13.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5164 -14.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2627 -15.0436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8088 -15.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6120 -15.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8620 -14.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7666 -14.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
3 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
13 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
10 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
23 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.49Molecular Weight (Monoisotopic): 519.1631AlogP: 5.04#Rotatable Bonds: 6Polar Surface Area: 117.59Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.95CX Basic pKa: 3.51CX LogP: 4.14CX LogD: 4.14Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -2.02
References 1. Wang XR, Wang S, Li WB, Xu KY, Qiao XP, Jing XL, Wang ZX, Yang CJ, Chen SW.. (2021) Design, synthesis and biological evaluation of novel 2-(4-(1H-indazol-6-yl)-1H-pyrazol-1-yl)acetamide derivatives as potent VEGFR-2 inhibitors., 213 [PMID:33493829 ] [10.1016/j.ejmech.2021.113192 ]