(R)-4-(7-chloro-4-(3-methylmorpholino)quinazolin-2-yl)-N-hydroxybenzamide

ID: ALA4872978

PubChem CID: 164625280

Max Phase: Preclinical

Molecular Formula: C20H19ClN4O3

Molecular Weight: 398.85

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@@H]1COCCN1c1nc(-c2ccc(C(=O)NO)cc2)nc2cc(Cl)ccc12

Standard InChI:  InChI=1S/C20H19ClN4O3/c1-12-11-28-9-8-25(12)19-16-7-6-15(21)10-17(16)22-18(23-19)13-2-4-14(5-3-13)20(26)24-27/h2-7,10,12,27H,8-9,11H2,1H3,(H,24,26)/t12-/m1/s1

Standard InChI Key:  MEWOWLRYSDUDAO-GFCCVEGCSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   38.0764   -4.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0752   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7833   -5.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7815   -3.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4901   -4.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4909   -5.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1994   -5.4405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.9077   -5.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9029   -4.2075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1938   -3.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6170   -5.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6153   -6.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3237   -6.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0308   -6.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0250   -5.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3160   -5.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7406   -6.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7449   -7.4662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.4462   -6.2367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.1560   -6.6416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1895   -2.9870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8994   -2.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8970   -1.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1890   -1.3555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4816   -1.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4824   -2.5864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6076   -2.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3672   -5.4456    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 10 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 22 27  1  1
  2 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4872978

    ---

Associated Targets(Human)

MTOR Tclin Serine/threonine-protein kinase mTOR (13850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC6 Tclin Histone deacetylase 6 (20808 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.85Molecular Weight (Monoisotopic): 398.1146AlogP: 3.29#Rotatable Bonds: 3
Polar Surface Area: 87.58Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.98CX Basic pKa: 3.98CX LogP: 3.95CX LogD: 3.94
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: -1.39

References

1. Yao D, Jiang J, Zhang H, Huang Y, Huang J, Wang J..  (2021)  Design, synthesis and biological evaluation of dual mTOR/HDAC6 inhibitors in MDA-MB-231 cells.,  47  [PMID:34139324] [10.1016/j.bmcl.2021.128204]

Source