The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Rac-(2S)-4-benzyl-N-(tert-butyl)-2-isobutyl-7-nitro-3-oxo-2,3,4,5-tetrahydro-1H-benzo[e][1,4]diazepine-5-carboxamide ID: ALA4873014
PubChem CID: 164624782
Max Phase: Preclinical
Molecular Formula: C25H32N4O4
Molecular Weight: 452.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H]1Nc2ccc([N+](=O)[O-])cc2C(C(=O)NC(C)(C)C)N(Cc2ccccc2)C1=O
Standard InChI: InChI=1S/C25H32N4O4/c1-16(2)13-21-24(31)28(15-17-9-7-6-8-10-17)22(23(30)27-25(3,4)5)19-14-18(29(32)33)11-12-20(19)26-21/h6-12,14,16,21-22,26H,13,15H2,1-5H3,(H,27,30)/t21-,22?/m0/s1
Standard InChI Key: AGTJLMSHMQGCPS-HMTLIYDFSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.5028 -10.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0942 -11.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9153 -11.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7847 -13.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5232 -13.8071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6998 -14.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3561 -15.2373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1784 -15.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8521 -14.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0438 -13.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4469 -13.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6580 -13.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4694 -14.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0678 -14.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7938 -12.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5101 -12.2184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0865 -12.2026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3884 -10.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4989 -14.7974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5295 -15.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1703 -13.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9327 -13.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0465 -14.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8080 -14.7266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4520 -14.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3335 -13.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5719 -13.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0669 -12.8905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2559 -12.0913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2797 -13.1243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3479 -16.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6949 -16.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8151 -15.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
10 4 1 0
4 5 1 0
5 6 1 0
9 7 1 0
6 8 1 0
7 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
4 15 1 0
15 16 2 0
15 17 1 0
17 2 1 0
2 18 1 0
6 19 2 0
8 20 1 6
5 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 1 0
28 30 2 0
12 28 1 0
20 31 1 0
31 32 1 0
31 33 1 0
M CHG 2 28 1 29 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2424AlogP: 4.42#Rotatable Bonds: 6Polar Surface Area: 104.58Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.86CX Basic pKa: ┄CX LogP: 3.96CX LogD: 3.96Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.68
References 1. Vézina-Dawod S, Perreault M, Guay LD, Gerber N, Gobeil S, Biron E.. (2021) Synthesis and biological evaluation of novel 1,4-benzodiazepin-3-one derivatives as potential antitumor agents against prostate cancer., 45 [PMID:34333393 ] [10.1016/j.bmc.2021.116314 ]