The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-Hydroxyhumantenine N4-Oxide ID: ALA4873044
PubChem CID: 164619924
Max Phase: Preclinical
Molecular Formula: C21H26N2O5
Molecular Weight: 386.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1\C[N@+](C)([O-])[C@H]2C[C@@]3(C(=O)N(OC)c4cc(O)ccc43)[C@H]3C[C@@H]1[C@@H]2CO3
Standard InChI: InChI=1S/C21H26N2O5/c1-4-12-10-23(2,26)18-9-21(19-8-14(12)15(18)11-28-19)16-6-5-13(24)7-17(16)22(27-3)20(21)25/h4-7,14-15,18-19,24H,8-11H2,1-3H3/b12-4+/t14-,15-,18-,19+,21-,23-/m0/s1
Standard InChI Key: VBBVZFKXDVGVIU-KLAWQQEOSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
33.7917 -2.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5835 -1.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9982 -2.8410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4177 -2.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4177 -2.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7143 -3.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9982 -2.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7080 -1.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5336 -0.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7092 -0.7058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6994 -2.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3859 -3.0087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1222 -2.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9904 -1.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8099 -2.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1877 -1.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7499 -1.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9254 -1.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5499 -1.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9947 -2.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2600 -3.8257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4856 -4.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8576 -3.0105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2151 -2.7818 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.4415 -1.1656 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
37.1580 -1.5852 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
34.2601 -3.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1575 -3.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1575 -4.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9937 -3.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9892 -1.1519 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.6906 -1.8190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7 3 1 0
3 6 1 0
5 4 1 0
4 8 1 0
5 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
4 11 1 0
11 1 1 0
14 2 1 6
14 16 1 0
15 12 1 0
12 13 1 0
13 14 1 0
1 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 21 1 0
21 22 1 0
13 23 2 0
1 24 1 1
8 25 1 6
4 26 1 1
3 27 1 1
5 28 2 0
28 29 1 0
3 30 1 0
7 31 1 6
19 32 1 0
10 1 1 0
7 2 1 0
M CHG 2 3 1 30 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.45Molecular Weight (Monoisotopic): 386.1842AlogP: 2.24#Rotatable Bonds: 1Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.94CX Basic pKa: 3.67CX LogP: 0.59CX LogD: 0.58Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.45Np Likeness Score: 2.92
References 1. Jin P, Zhan G, Zheng G, Liu J, Peng X, Huang L, Gao B, Yuan X, Yao G.. (2021) Gelstriamine A, a Triamino Monoterpene Indole Alkaloid with a Caged 6/5/7/6/6/5 Scaffold and Analgesic Alkaloids from Gelsemium elegans Stems., 84 (4.0): [PMID:33826318 ] [10.1021/acs.jnatprod.1c00062 ]