The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((4-(2-Chloroacetamido)benzyl)amino)-7-((3,5-dimethoxyphenyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4873050
PubChem CID: 164619928
Max Phase: Preclinical
Molecular Formula: C24H24ClN7O4
Molecular Weight: 509.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2nc(NCc3ccc(NC(=O)CCl)cc3)n3ccnc3c2C(N)=O)cc(OC)c1
Standard InChI: InChI=1S/C24H24ClN7O4/c1-35-17-9-16(10-18(11-17)36-2)30-22-20(21(26)34)23-27-7-8-32(23)24(31-22)28-13-14-3-5-15(6-4-14)29-19(33)12-25/h3-11,30H,12-13H2,1-2H3,(H2,26,34)(H,28,31)(H,29,33)
Standard InChI Key: NCSKDJCXOYGDLC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
17.2711 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2711 -4.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9831 -5.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6951 -4.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9831 -3.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6921 -3.9899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3058 -3.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9761 -2.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1587 -2.7726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4098 -5.2290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4101 -6.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1248 -6.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5554 -3.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5530 -2.7563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8422 -3.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5572 -5.2303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5584 -6.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8432 -6.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8440 -7.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5597 -7.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2759 -7.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2715 -6.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9925 -7.6941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9965 -8.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1299 -7.7040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1307 -8.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1229 -7.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8366 -7.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5520 -7.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5490 -6.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8346 -6.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2672 -7.6992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9810 -7.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6961 -7.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9794 -6.4604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4099 -7.2830 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
10 11 1 0
11 12 1 0
1 13 1 0
13 14 1 0
13 15 2 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
19 25 1 0
25 26 1 0
12 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 12 1 0
29 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.95Molecular Weight (Monoisotopic): 509.1578AlogP: 3.38#Rotatable Bonds: 10Polar Surface Area: 144.90Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.64CX Basic pKa: 5.10CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.30
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]