N-(2-chloropyridin-3-yl)-2-((6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-yl)thio)acetamide

ID: ALA4873086

PubChem CID: 164625307

Max Phase: Preclinical

Molecular Formula: C21H14ClI2N5O4S2

Molecular Weight: 753.77

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3cccnc3Cl)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C21H14ClI2N5O4S2/c22-19-16(2-1-7-26-19)27-17(30)10-34-21-28-18-14(8-11(23)9-15(18)24)20(31)29(21)12-3-5-13(6-4-12)35(25,32)33/h1-9H,10H2,(H,27,30)(H2,25,32,33)

Standard InChI Key:  FEDAPOSTGIZCGZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   43.7940   -9.0510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2067   -9.7609    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.6152   -9.0485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5345  -11.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5334  -12.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2414  -12.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2396  -10.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9482  -11.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9471  -12.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6572  -12.6199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.3730  -12.2106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3742  -11.3854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6595  -10.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8267  -10.9786    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   39.2411  -13.4327    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   40.6596  -10.1523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.0812  -10.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7882  -11.3932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4964  -10.9870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4988  -10.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7872   -9.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0818  -10.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0795  -12.6212    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.9143  -10.1705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.7884  -12.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4950  -12.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2038  -12.2186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4927  -13.4424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9104  -12.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9033  -13.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6090  -13.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3189  -13.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3186  -12.6259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.6123  -12.2191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6097  -11.4019    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4873086

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 753.77Molecular Weight (Monoisotopic): 752.8265AlogP: 4.02#Rotatable Bonds: 6
Polar Surface Area: 137.04Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.12CX Basic pKa: 0.63CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.13Np Likeness Score: -2.34

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source