The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-methylisoxazol-3-yl)-4-(4-oxo-2-(4-(trifluoromethyl)phenyl)thiazolidin-3-yl)benzenesulfonamide ID: ALA4873097
PubChem CID: 164619933
Max Phase: Preclinical
Molecular Formula: C20H16F3N3O4S2
Molecular Weight: 483.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(NS(=O)(=O)c2ccc(N3C(=O)CSC3c3ccc(C(F)(F)F)cc3)cc2)no1
Standard InChI: InChI=1S/C20H16F3N3O4S2/c1-12-10-17(24-30-12)25-32(28,29)16-8-6-15(7-9-16)26-18(27)11-31-19(26)13-2-4-14(5-3-13)20(21,22)23/h2-10,19H,11H2,1H3,(H,24,25)
Standard InChI Key: ALGIIILPRCPZCT-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
11.4002 -4.6168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2253 -4.6168 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.8128 -3.9023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8210 -9.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6461 -9.1878 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.9029 -8.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2336 -7.9168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5685 -8.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6841 -8.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2963 -8.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0807 -8.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2540 -7.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6366 -7.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8547 -7.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2323 -7.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9478 -6.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9469 -5.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2313 -5.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5150 -5.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5195 -6.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9423 -4.2029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9399 -3.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6049 -2.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3477 -2.1097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5227 -2.1121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2701 -2.8975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8307 -1.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7838 -8.1490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0386 -7.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6517 -7.9393 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8212 -6.5835 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.6212 -6.7960 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
7 15 1 0
18 2 1 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
24 27 1 0
8 28 2 0
12 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.49Molecular Weight (Monoisotopic): 483.0534AlogP: 4.58#Rotatable Bonds: 5Polar Surface Area: 92.51Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.86CX Basic pKa: 0.38CX LogP: 3.70CX LogD: 2.85Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -1.92